C21H15FIN5O3 — CID 166081113
8-(3-aminophenyl)-6-cyclopropyl-4-(2-fluoro-4-iodoanilino)pyridazino[4,5-e][1,3]oxazine-2,5-dione (PubChem CID 166081113) has the molecular formula C21H15FIN5O3 and a molecular weight of 531.29 g/mol. Its IUPAC name is 8-(3-aminophenyl)-6-cyclopropyl-4-(2-fluoro-4-iodoanilino)pyridazino[4,5-e][1,3]oxazine-2,5-dione.
| Compound Name | 8-(3-aminophenyl)-6-cyclopropyl-4-(2-fluoro-4-iodoanilino)pyridazino[4,5-e][1,3]oxazine-2,5-dione |
|---|---|
| PubChem CID | 166081113 |
| Molecular Formula | C21H15FIN5O3 |
| Molecular Weight | 531.29 g/mol |
| Exact Mass | 531.02 |
| IUPAC Name | 8-(3-aminophenyl)-6-cyclopropyl-4-(2-fluoro-4-iodoanilino)pyridazino[4,5-e][1,3]oxazine-2,5-dione |
| SMILES | Nc1cccc(-c2nn(C3CC3)c(=O)c3c(Nc4ccc(I)cc4F)nc(=O)oc23)c1 |
| InChI | InChI=1S/C21H15FIN5O3/c22-14-9-11(23)4-7-15(14)25-19-16-18(31-21(30)26-19)17(10-2-1-3-12(24)8-10)27-28(20(16)29)13-5-6-13/h1-4,7-9,13H,5-6,24H2,(H,25,26,30) |
| InChIKey | UGMUQDDBRLEXGX-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 116.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.29 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|