C15H11FIN3O3 — CID 166081178
1-(2-fluoro-4-iodophenyl)-6,8-dimethylpyrido[2,3-d]pyrimidine-2,4,7-trione (PubChem CID 166081178) has the molecular formula C15H11FIN3O3 and a molecular weight of 427.17 g/mol. Its IUPAC name is 1-(2-fluoro-4-iodophenyl)-6,8-dimethylpyrido[2,3-d]pyrimidine-2,4,7-trione.
| Compound Name | 1-(2-fluoro-4-iodophenyl)-6,8-dimethylpyrido[2,3-d]pyrimidine-2,4,7-trione |
|---|---|
| PubChem CID | 166081178 |
| Molecular Formula | C15H11FIN3O3 |
| Molecular Weight | 427.17 g/mol |
| Exact Mass | 426.98 |
| IUPAC Name | 1-(2-fluoro-4-iodophenyl)-6,8-dimethylpyrido[2,3-d]pyrimidine-2,4,7-trione |
| SMILES | Cc1cc2c(=O)[nH]c(=O)n(-c3ccc(I)cc3F)c2n(C)c1=O |
| InChI | InChI=1S/C15H11FIN3O3/c1-7-5-9-12(21)18-15(23)20(13(9)19(2)14(7)22)11-4-3-8(17)6-10(11)16/h3-6H,1-2H3,(H,18,21,23) |
| InChIKey | LTCDPKGSOLDRLO-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 76.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.17 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|