C20H14ClF3N6S2 — CID 166081924
1-N-(2-chloro-3-methylphenyl)sulfanyl-2,4,5-trifluoro-3-N-(6-methylsulfanylpyrimido[5,4-d]pyrimidin-4-yl)benzene-1,3-diamine (PubChem CID 166081924) has the molecular formula C20H14ClF3N6S2 and a molecular weight of 494.96 g/mol. Its IUPAC name is 1-N-(2-chloro-3-methylphenyl)sulfanyl-2,4,5-trifluoro-3-N-(6-methylsulfanylpyrimido[5,4-d]pyrimidin-4-yl)benzene-1,3-diamine.
| Compound Name | 1-N-(2-chloro-3-methylphenyl)sulfanyl-2,4,5-trifluoro-3-N-(6-methylsulfanylpyrimido[5,4-d]pyrimidin-4-yl)benzene-1,3-diamine |
|---|---|
| PubChem CID | 166081924 |
| Molecular Formula | C20H14ClF3N6S2 |
| Molecular Weight | 494.96 g/mol |
| Exact Mass | 494.04 |
| IUPAC Name | 1-N-(2-chloro-3-methylphenyl)sulfanyl-2,4,5-trifluoro-3-N-(6-methylsulfanylpyrimido[5,4-d]pyrimidin-4-yl)benzene-1,3-diamine |
| SMILES | CSc1ncc2ncnc(Nc3c(F)c(F)cc(NSc4cccc(C)c4Cl)c3F)c2n1 |
| InChI | InChI=1S/C20H14ClF3N6S2/c1-9-4-3-5-13(14(9)21)32-30-11-6-10(22)15(23)18(16(11)24)28-19-17-12(26-8-27-19)7-25-20(29-17)31-2/h3-8,30H,1-2H3,(H,26,27,28) |
| InChIKey | NHOUATJMKBGLOH-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 75.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.96 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|