C15H28O2 — CID 166082831
(3aR)-3,3a,6,8,8-pentamethyl-2,3,4,5,7,8a-hexahydro-1H-azulene-5,6-diol (PubChem CID 166082831) has the molecular formula C15H28O2 and a molecular weight of 240.39 g/mol. Its IUPAC name is (3aR)-3,3a,6,8,8-pentamethyl-2,3,4,5,7,8a-hexahydro-1H-azulene-5,6-diol.
| Compound Name | (3aR)-3,3a,6,8,8-pentamethyl-2,3,4,5,7,8a-hexahydro-1H-azulene-5,6-diol |
|---|---|
| PubChem CID | 166082831 |
| Molecular Formula | C15H28O2 |
| Molecular Weight | 240.39 g/mol |
| Exact Mass | 240.21 |
| IUPAC Name | (3aR)-3,3a,6,8,8-pentamethyl-2,3,4,5,7,8a-hexahydro-1H-azulene-5,6-diol |
| SMILES | CC1CCC2C(C)(C)CC(C)(O)C(O)C[C@]12C |
| InChI | InChI=1S/C15H28O2/c1-10-6-7-11-13(2,3)9-15(5,17)12(16)8-14(10,11)4/h10-12,16-17H,6-9H2,1-5H3/t10?,11?,12?,14-,15?/m1/s1 |
| InChIKey | WJLNLGUBLQSSBM-WINGCZCQSA-N |
| XLogP | 2.97 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.39 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |