About (E)-4-(5,5-dimethylcyclohexen-1-yl)but-3-en-2-one
(E)-4-(5,5-dimethylcyclohexen-1-yl)but-3-en-2-one (PubChem CID 166083138) has the molecular formula C12H18O
and a molecular weight of 178.28 g/mol. Its IUPAC name is (E)-4-(5,5-dimethylcyclohexen-1-yl)but-3-en-2-one.
Molecular Properties
| Compound Name | (E)-4-(5,5-dimethylcyclohexen-1-yl)but-3-en-2-one |
| PubChem CID | 166083138 |
| Molecular Formula | C12H18O |
| Molecular Weight | 178.28 g/mol |
| Exact Mass | 178.14 |
| IUPAC Name | (E)-4-(5,5-dimethylcyclohexen-1-yl)but-3-en-2-one |
| SMILES | CC(=O)/C=C/C1=CCCC(C)(C)C1 |
| InChI | InChI=1S/C12H18O/c1-10(13)6-7-11-5-4-8-12(2,3)9-11/h5-7H,4,8-9H2,1-3H3/b7-6+ |
| InChIKey | OSZOPVVHAHCGAL-VOTSOKGWSA-N |
| XLogP | 3.27 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.28 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-4-(5,5-dimethylcyclohexen-1-yl)but-3-en-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-4-(5,5-dimethylcyclohexen-1-yl)but-3-en-2-one?
The IUPAC name of (E)-4-(5,5-dimethylcyclohexen-1-yl)but-3-en-2-one (CID 166083138) is (E)-4-(5,5-dimethylcyclohexen-1-yl)but-3-en-2-one.
What is the SMILES notation for (E)-4-(5,5-dimethylcyclohexen-1-yl)but-3-en-2-one?
The canonical SMILES for (E)-4-(5,5-dimethylcyclohexen-1-yl)but-3-en-2-one is CC(=O)/C=C/C1=CCCC(C)(C)C1.
What is the InChIKey of (E)-4-(5,5-dimethylcyclohexen-1-yl)but-3-en-2-one?
The InChIKey is OSZOPVVHAHCGAL-VOTSOKGWSA-N. The full InChI is InChI=1S/C12H18O/c1-10(13)6-7-11-5-4-8-12(2,3)9-11/h5-7H,4,8-9H2,1-3H3/b7-6+.
What are the key properties of (E)-4-(5,5-dimethylcyclohexen-1-yl)but-3-en-2-one?
(E)-4-(5,5-dimethylcyclohexen-1-yl)but-3-en-2-one has a molecular weight of 178.28 g/mol, XLogP of 3.27, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-4-(5,5-dimethylcyclohexen-1-yl)but-3-en-2-one is sourced from PubChem (CID 166083138), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).