About 5-chloro-3-(5-methyl-1,2-oxazol-3-yl)-1-propylpyrazole-4-carbaldehyde
5-chloro-3-(5-methyl-1,2-oxazol-3-yl)-1-propylpyrazole-4-carbaldehyde (PubChem CID 166083367) has the molecular formula C11H12ClN3O2
and a molecular weight of 253.69 g/mol. Its IUPAC name is 5-chloro-3-(5-methyl-1,2-oxazol-3-yl)-1-propylpyrazole-4-carbaldehyde.
Molecular Properties
| Compound Name | 5-chloro-3-(5-methyl-1,2-oxazol-3-yl)-1-propylpyrazole-4-carbaldehyde |
| PubChem CID | 166083367 |
| Molecular Formula | C11H12ClN3O2 |
| Molecular Weight | 253.69 g/mol |
| Exact Mass | 253.06 |
| IUPAC Name | 5-chloro-3-(5-methyl-1,2-oxazol-3-yl)-1-propylpyrazole-4-carbaldehyde |
| SMILES | CCCn1nc(-c2cc(C)on2)c(C=O)c1Cl |
| InChI | InChI=1S/C11H12ClN3O2/c1-3-4-15-11(12)8(6-16)10(13-15)9-5-7(2)17-14-9/h5-6H,3-4H2,1-2H3 |
| InChIKey | MTTLYVCEVZNDCE-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 60.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.69 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 5-chloro-3-(5-methyl-1,2-oxazol-3-yl)-1-propylpyrazole-4-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-3-(5-methyl-1,2-oxazol-3-yl)-1-propylpyrazole-4-carbaldehyde?
The IUPAC name of 5-chloro-3-(5-methyl-1,2-oxazol-3-yl)-1-propylpyrazole-4-carbaldehyde (CID 166083367) is 5-chloro-3-(5-methyl-1,2-oxazol-3-yl)-1-propylpyrazole-4-carbaldehyde.
What is the SMILES notation for 5-chloro-3-(5-methyl-1,2-oxazol-3-yl)-1-propylpyrazole-4-carbaldehyde?
The canonical SMILES for 5-chloro-3-(5-methyl-1,2-oxazol-3-yl)-1-propylpyrazole-4-carbaldehyde is CCCn1nc(-c2cc(C)on2)c(C=O)c1Cl.
What is the InChIKey of 5-chloro-3-(5-methyl-1,2-oxazol-3-yl)-1-propylpyrazole-4-carbaldehyde?
The InChIKey is MTTLYVCEVZNDCE-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12ClN3O2/c1-3-4-15-11(12)8(6-16)10(13-15)9-5-7(2)17-14-9/h5-6H,3-4H2,1-2H3.
What are the key properties of 5-chloro-3-(5-methyl-1,2-oxazol-3-yl)-1-propylpyrazole-4-carbaldehyde?
5-chloro-3-(5-methyl-1,2-oxazol-3-yl)-1-propylpyrazole-4-carbaldehyde has a molecular weight of 253.69 g/mol, XLogP of 2.72, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-3-(5-methyl-1,2-oxazol-3-yl)-1-propylpyrazole-4-carbaldehyde is sourced from PubChem (CID 166083367), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).