C11H12ClN3O2 — CID 166083367
5-chloro-3-(5-methyl-1,2-oxazol-3-yl)-1-propylpyrazole-4-carbaldehyde (PubChem CID 166083367) has the molecular formula C11H12ClN3O2 and a molecular weight of 253.69 g/mol. Its IUPAC name is 5-chloro-3-(5-methyl-1,2-oxazol-3-yl)-1-propylpyrazole-4-carbaldehyde.
| Compound Name | 5-chloro-3-(5-methyl-1,2-oxazol-3-yl)-1-propylpyrazole-4-carbaldehyde |
|---|---|
| PubChem CID | 166083367 |
| Molecular Formula | C11H12ClN3O2 |
| Molecular Weight | 253.69 g/mol |
| Exact Mass | 253.06 |
| IUPAC Name | 5-chloro-3-(5-methyl-1,2-oxazol-3-yl)-1-propylpyrazole-4-carbaldehyde |
| SMILES | CCCn1nc(-c2cc(C)on2)c(C=O)c1Cl |
| InChI | InChI=1S/C11H12ClN3O2/c1-3-4-15-11(12)8(6-16)10(13-15)9-5-7(2)17-14-9/h5-6H,3-4H2,1-2H3 |
| InChIKey | MTTLYVCEVZNDCE-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 60.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.69 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|