C24H38ClN5O2 — CID 166083702
3-amino-2-[9-(3,3-dimethylbutyl)-3,9-diazaspiro[5.5]undecane-3-carbonyl]-N-ethyl-3-(1,2-oxazol-3-yl)prop-2-enimidoyl chloride (PubChem CID 166083702) has the molecular formula C24H38ClN5O2 and a molecular weight of 464.05 g/mol. Its IUPAC name is 3-amino-2-[9-(3,3-dimethylbutyl)-3,9-diazaspiro[5.5]undecane-3-carbonyl]-N-ethyl-3-(1,2-oxazol-3-yl)prop-2-enimidoyl chloride.
| Compound Name | 3-amino-2-[9-(3,3-dimethylbutyl)-3,9-diazaspiro[5.5]undecane-3-carbonyl]-N-ethyl-3-(1,2-oxazol-3-yl)prop-2-enimidoyl chloride |
|---|---|
| PubChem CID | 166083702 |
| Molecular Formula | C24H38ClN5O2 |
| Molecular Weight | 464.05 g/mol |
| Exact Mass | 463.27 |
| IUPAC Name | 3-amino-2-[9-(3,3-dimethylbutyl)-3,9-diazaspiro[5.5]undecane-3-carbonyl]-N-ethyl-3-(1,2-oxazol-3-yl)prop-2-enimidoyl chloride |
| SMILES | CC/N=C(\Cl)C(C(=O)N1CCC2(CCN(CCC(C)(C)C)CC2)CC1)=C(N)c1ccon1 |
| InChI | InChI=1S/C24H38ClN5O2/c1-5-27-21(25)19(20(26)18-6-17-32-28-18)22(31)30-15-10-24(11-16-30)8-13-29(14-9-24)12-7-23(2,3)4/h6,17H,5,7-16,26H2,1-4H3/b20-19?,27-21- |
| InChIKey | SWJAGDCJBUCFQV-QZMCVJTASA-N |
| XLogP | 4.14 |
| TPSA | 87.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.05 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|