C26H31N5O2 — CID 166083914
[4-(5-tert-butyl-1,2,4-oxadiazol-3-yl)phenyl]-[6-(4,5,6,7-tetrahydroindazol-1-yl)-2-azaspiro[3.3]heptan-2-yl]methanone (PubChem CID 166083914) has the molecular formula C26H31N5O2 and a molecular weight of 445.57 g/mol. Its IUPAC name is [4-(5-tert-butyl-1,2,4-oxadiazol-3-yl)phenyl]-[6-(4,5,6,7-tetrahydroindazol-1-yl)-2-azaspiro[3.3]heptan-2-yl]methanone.
| Compound Name | [4-(5-tert-butyl-1,2,4-oxadiazol-3-yl)phenyl]-[6-(4,5,6,7-tetrahydroindazol-1-yl)-2-azaspiro[3.3]heptan-2-yl]methanone |
|---|---|
| PubChem CID | 166083914 |
| Molecular Formula | C26H31N5O2 |
| Molecular Weight | 445.57 g/mol |
| Exact Mass | 445.25 |
| IUPAC Name | [4-(5-tert-butyl-1,2,4-oxadiazol-3-yl)phenyl]-[6-(4,5,6,7-tetrahydroindazol-1-yl)-2-azaspiro[3.3]heptan-2-yl]methanone |
| SMILES | CC(C)(C)c1nc(-c2ccc(C(=O)N3CC4(CC(n5ncc6c5CCCC6)C4)C3)cc2)no1 |
| InChI | InChI=1S/C26H31N5O2/c1-25(2,3)24-28-22(29-33-24)17-8-10-18(11-9-17)23(32)30-15-26(16-30)12-20(13-26)31-21-7-5-4-6-19(21)14-27-31/h8-11,14,20H,4-7,12-13,15-16H2,1-3H3 |
| InChIKey | GSAVLCUQSUOFRA-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 77.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.57 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |