About N-ethenyl-N,N'-dimethylpentanimidamide
N-ethenyl-N,N'-dimethylpentanimidamide (PubChem CID 166084190) has the molecular formula C9H18N2
and a molecular weight of 154.26 g/mol. Its IUPAC name is N-ethenyl-N,N'-dimethylpentanimidamide.
Molecular Properties
| Compound Name | N-ethenyl-N,N'-dimethylpentanimidamide |
| PubChem CID | 166084190 |
| Molecular Formula | C9H18N2 |
| Molecular Weight | 154.26 g/mol |
| Exact Mass | 154.15 |
| IUPAC Name | N-ethenyl-N,N'-dimethylpentanimidamide |
| SMILES | C=CN(C)/C(CCCC)=N/C |
| InChI | InChI=1S/C9H18N2/c1-5-7-8-9(10-3)11(4)6-2/h6H,2,5,7-8H2,1,3-4H3/b10-9+ |
| InChIKey | ANGCTQHRBRTERU-MDZDMXLPSA-N |
| XLogP | 2.28 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.26 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N-ethenyl-N,N'-dimethylpentanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethenyl-N,N'-dimethylpentanimidamide?
The IUPAC name of N-ethenyl-N,N'-dimethylpentanimidamide (CID 166084190) is N-ethenyl-N,N'-dimethylpentanimidamide.
What is the SMILES notation for N-ethenyl-N,N'-dimethylpentanimidamide?
The canonical SMILES for N-ethenyl-N,N'-dimethylpentanimidamide is C=CN(C)/C(CCCC)=N/C.
What is the InChIKey of N-ethenyl-N,N'-dimethylpentanimidamide?
The InChIKey is ANGCTQHRBRTERU-MDZDMXLPSA-N. The full InChI is InChI=1S/C9H18N2/c1-5-7-8-9(10-3)11(4)6-2/h6H,2,5,7-8H2,1,3-4H3/b10-9+.
What are the key properties of N-ethenyl-N,N'-dimethylpentanimidamide?
N-ethenyl-N,N'-dimethylpentanimidamide has a molecular weight of 154.26 g/mol, XLogP of 2.28, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethenyl-N,N'-dimethylpentanimidamide is sourced from PubChem (CID 166084190), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).