C12H13NO4 — CID 166084429
(2,5-dioxopyrrolidin-1-yl) (1S,2R,4S)-bicyclo[2.2.1]hept-5-ene-2-carboxylate (PubChem CID 166084429) has the molecular formula C12H13NO4 and a molecular weight of 235.24 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) (1S,2R,4S)-bicyclo[2.2.1]hept-5-ene-2-carboxylate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) (1S,2R,4S)-bicyclo[2.2.1]hept-5-ene-2-carboxylate |
|---|---|
| PubChem CID | 166084429 |
| Molecular Formula | C12H13NO4 |
| Molecular Weight | 235.24 g/mol |
| Exact Mass | 235.08 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) (1S,2R,4S)-bicyclo[2.2.1]hept-5-ene-2-carboxylate |
| SMILES | O=C(ON1C(=O)CCC1=O)[C@@H]1C[C@H]2C=C[C@@H]1C2 |
| InChI | InChI=1S/C12H13NO4/c14-10-3-4-11(15)13(10)17-12(16)9-6-7-1-2-8(9)5-7/h1-2,7-9H,3-6H2/t7-,8+,9+/m0/s1 |
| InChIKey | XMCIHUNYRDAXMZ-DJLDLDEBSA-N |
| XLogP | 0.81 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.24 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|