C40H32ClNO — CID 166084693
N-(4-tert-butylphenyl)-4-chloro-N-(3,5-diphenylphenyl)dibenzofuran-2-amine (PubChem CID 166084693) has the molecular formula C40H32ClNO and a molecular weight of 578.16 g/mol. Its IUPAC name is N-(4-tert-butylphenyl)-4-chloro-N-(3,5-diphenylphenyl)dibenzofuran-2-amine.
| Compound Name | N-(4-tert-butylphenyl)-4-chloro-N-(3,5-diphenylphenyl)dibenzofuran-2-amine |
|---|---|
| PubChem CID | 166084693 |
| Molecular Formula | C40H32ClNO |
| Molecular Weight | 578.16 g/mol |
| Exact Mass | 577.22 |
| IUPAC Name | N-(4-tert-butylphenyl)-4-chloro-N-(3,5-diphenylphenyl)dibenzofuran-2-amine |
| SMILES | CC(C)(C)c1ccc(N(c2cc(-c3ccccc3)cc(-c3ccccc3)c2)c2cc(Cl)c3oc4ccccc4c3c2)cc1 |
| InChI | InChI=1S/C40H32ClNO/c1-40(2,3)31-18-20-32(21-19-31)42(34-25-36-35-16-10-11-17-38(35)43-39(36)37(41)26-34)33-23-29(27-12-6-4-7-13-27)22-30(24-33)28-14-8-5-9-15-28/h4-26H,1-3H3 |
| InChIKey | WTZYLWQUQFPRJN-UHFFFAOYSA-N |
| XLogP | 12.34 |
| TPSA | 16.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.16 |
| LogP ≤ 5 | 12.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |