About 3-cyclobutyl-4,4,4-trifluoro-3-hydroxybutan-2-one
3-cyclobutyl-4,4,4-trifluoro-3-hydroxybutan-2-one (PubChem CID 166085011) has the molecular formula C8H11F3O2
and a molecular weight of 196.17 g/mol. Its IUPAC name is 3-cyclobutyl-4,4,4-trifluoro-3-hydroxybutan-2-one.
Molecular Properties
| Compound Name | 3-cyclobutyl-4,4,4-trifluoro-3-hydroxybutan-2-one |
| PubChem CID | 166085011 |
| Molecular Formula | C8H11F3O2 |
| Molecular Weight | 196.17 g/mol |
| Exact Mass | 196.07 |
| IUPAC Name | 3-cyclobutyl-4,4,4-trifluoro-3-hydroxybutan-2-one |
| SMILES | CC(=O)C(O)(C1CCC1)C(F)(F)F |
| InChI | InChI=1S/C8H11F3O2/c1-5(12)7(13,8(9,10)11)6-3-2-4-6/h6,13H,2-4H2,1H3 |
| InChIKey | KKRGNWPFHIYCCP-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.17 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-cyclobutyl-4,4,4-trifluoro-3-hydroxybutan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-cyclobutyl-4,4,4-trifluoro-3-hydroxybutan-2-one?
The IUPAC name of 3-cyclobutyl-4,4,4-trifluoro-3-hydroxybutan-2-one (CID 166085011) is 3-cyclobutyl-4,4,4-trifluoro-3-hydroxybutan-2-one.
What is the SMILES notation for 3-cyclobutyl-4,4,4-trifluoro-3-hydroxybutan-2-one?
The canonical SMILES for 3-cyclobutyl-4,4,4-trifluoro-3-hydroxybutan-2-one is CC(=O)C(O)(C1CCC1)C(F)(F)F.
What is the InChIKey of 3-cyclobutyl-4,4,4-trifluoro-3-hydroxybutan-2-one?
The InChIKey is KKRGNWPFHIYCCP-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11F3O2/c1-5(12)7(13,8(9,10)11)6-3-2-4-6/h6,13H,2-4H2,1H3.
What are the key properties of 3-cyclobutyl-4,4,4-trifluoro-3-hydroxybutan-2-one?
3-cyclobutyl-4,4,4-trifluoro-3-hydroxybutan-2-one has a molecular weight of 196.17 g/mol, XLogP of 1.67, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-cyclobutyl-4,4,4-trifluoro-3-hydroxybutan-2-one is sourced from PubChem (CID 166085011), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).