C23H32ClN5O3S — CID 166085270
1-[4-[3-[4-(4-acetylpiperazine-1-carbonyl)-3-chloroanilino]azetidin-1-yl]piperidin-1-yl]-2-sulfanylethanone (PubChem CID 166085270) has the molecular formula C23H32ClN5O3S and a molecular weight of 494.06 g/mol. Its IUPAC name is 1-[4-[3-[4-(4-acetylpiperazine-1-carbonyl)-3-chloroanilino]azetidin-1-yl]piperidin-1-yl]-2-sulfanylethanone.
| Compound Name | 1-[4-[3-[4-(4-acetylpiperazine-1-carbonyl)-3-chloroanilino]azetidin-1-yl]piperidin-1-yl]-2-sulfanylethanone |
|---|---|
| PubChem CID | 166085270 |
| Molecular Formula | C23H32ClN5O3S |
| Molecular Weight | 494.06 g/mol |
| Exact Mass | 493.19 |
| IUPAC Name | 1-[4-[3-[4-(4-acetylpiperazine-1-carbonyl)-3-chloroanilino]azetidin-1-yl]piperidin-1-yl]-2-sulfanylethanone |
| SMILES | CC(=O)N1CCN(C(=O)c2ccc(NC3CN(C4CCN(C(=O)CS)CC4)C3)cc2Cl)CC1 |
| InChI | InChI=1S/C23H32ClN5O3S/c1-16(30)26-8-10-28(11-9-26)23(32)20-3-2-17(12-21(20)24)25-18-13-29(14-18)19-4-6-27(7-5-19)22(31)15-33/h2-3,12,18-19,25,33H,4-11,13-15H2,1H3 |
| InChIKey | DKDZCRPUWUVGRA-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 76.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.06 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|