C21H23F4N7O3 — CID 166085439
[(2S)-1-[7-amino-2-(furan-2-yl)-[1,3]oxazolo[5,4-d]pyrimidin-5-yl]pyrrolidin-2-yl]-[4-(2,2,3,3-tetrafluoropropyl)piperazin-1-yl]methanone (PubChem CID 166085439) has the molecular formula C21H23F4N7O3 and a molecular weight of 497.45 g/mol. Its IUPAC name is [(2S)-1-[7-amino-2-(furan-2-yl)-[1,3]oxazolo[5,4-d]pyrimidin-5-yl]pyrrolidin-2-yl]-[4-(2,2,3,3-tetrafluoropropyl)piperazin-1-yl]methanone.
| Compound Name | [(2S)-1-[7-amino-2-(furan-2-yl)-[1,3]oxazolo[5,4-d]pyrimidin-5-yl]pyrrolidin-2-yl]-[4-(2,2,3,3-tetrafluoropropyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 166085439 |
| Molecular Formula | C21H23F4N7O3 |
| Molecular Weight | 497.45 g/mol |
| Exact Mass | 497.18 |
| IUPAC Name | [(2S)-1-[7-amino-2-(furan-2-yl)-[1,3]oxazolo[5,4-d]pyrimidin-5-yl]pyrrolidin-2-yl]-[4-(2,2,3,3-tetrafluoropropyl)piperazin-1-yl]methanone |
| SMILES | Nc1nc(N2CCC[C@H]2C(=O)N2CCN(CC(F)(F)C(F)F)CC2)nc2oc(-c3ccco3)nc12 |
| InChI | InChI=1S/C21H23F4N7O3/c22-19(23)21(24,25)11-30-6-8-31(9-7-30)18(33)12-3-1-5-32(12)20-28-15(26)14-17(29-20)35-16(27-14)13-4-2-10-34-13/h2,4,10,12,19H,1,3,5-9,11H2,(H2,26,28,29)/t12-/m0/s1 |
| InChIKey | LXFLBJNHLQGKFS-LBPRGKRZSA-N |
| XLogP | 2.47 |
| TPSA | 117.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.45 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|