C20H27N9O4S — CID 166085460
[(2S)-1-[7-amino-2-(furan-2-yl)-[1,2,4]triazolo[1,5-a][1,3,5]triazin-5-yl]pyrrolidin-2-yl]-(4-propan-2-ylsulfonylpiperazin-1-yl)methanone (PubChem CID 166085460) has the molecular formula C20H27N9O4S and a molecular weight of 489.56 g/mol. Its IUPAC name is [(2S)-1-[7-amino-2-(furan-2-yl)-[1,2,4]triazolo[1,5-a][1,3,5]triazin-5-yl]pyrrolidin-2-yl]-(4-propan-2-ylsulfonylpiperazin-1-yl)methanone.
| Compound Name | [(2S)-1-[7-amino-2-(furan-2-yl)-[1,2,4]triazolo[1,5-a][1,3,5]triazin-5-yl]pyrrolidin-2-yl]-(4-propan-2-ylsulfonylpiperazin-1-yl)methanone |
|---|---|
| PubChem CID | 166085460 |
| Molecular Formula | C20H27N9O4S |
| Molecular Weight | 489.56 g/mol |
| Exact Mass | 489.19 |
| IUPAC Name | [(2S)-1-[7-amino-2-(furan-2-yl)-[1,2,4]triazolo[1,5-a][1,3,5]triazin-5-yl]pyrrolidin-2-yl]-(4-propan-2-ylsulfonylpiperazin-1-yl)methanone |
| SMILES | CC(C)S(=O)(=O)N1CCN(C(=O)[C@@H]2CCCN2c2nc(N)n3nc(-c4ccco4)nc3n2)CC1 |
| InChI | InChI=1S/C20H27N9O4S/c1-13(2)34(31,32)27-10-8-26(9-11-27)17(30)14-5-3-7-28(14)19-23-18(21)29-20(24-19)22-16(25-29)15-6-4-12-33-15/h4,6,12-14H,3,5,7-11H2,1-2H3,(H2,21,22,23,24,25)/t14-/m0/s1 |
| InChIKey | SKLZBXUKSIBUJM-AWEZNQCLSA-N |
| XLogP | 0.21 |
| TPSA | 156.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.56 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |