C21H31Cl2N2O4+ — CID 166087071
chloromethane;(4-methylmorpholin-4-ium-4-yl)methyl N-[1-(2-chlorophenyl)-2-oxocyclohexyl]-N-methylcarbamate (PubChem CID 166087071) has the molecular formula C21H31Cl2N2O4+ and a molecular weight of 446.40 g/mol. Its IUPAC name is chloromethane;(4-methylmorpholin-4-ium-4-yl)methyl N-[1-(2-chlorophenyl)-2-oxocyclohexyl]-N-methylcarbamate.
| Compound Name | chloromethane;(4-methylmorpholin-4-ium-4-yl)methyl N-[1-(2-chlorophenyl)-2-oxocyclohexyl]-N-methylcarbamate |
|---|---|
| PubChem CID | 166087071 |
| Molecular Formula | C21H31Cl2N2O4+ |
| Molecular Weight | 446.40 g/mol |
| Exact Mass | 445.17 |
| IUPAC Name | chloromethane;(4-methylmorpholin-4-ium-4-yl)methyl N-[1-(2-chlorophenyl)-2-oxocyclohexyl]-N-methylcarbamate |
| SMILES | CCl.CN(C(=O)OC[N+]1(C)CCOCC1)C1(c2ccccc2Cl)CCCCC1=O |
| InChI | InChI=1S/C20H28ClN2O4.CH3Cl/c1-22(19(25)27-15-23(2)11-13-26-14-12-23)20(10-6-5-9-18(20)24)16-7-3-4-8-17(16)21;1-2/h3-4,7-8H,5-6,9-15H2,1-2H3;1H3/q+1; |
| InChIKey | KYIQNFFAFCFRLI-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.40 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|