C23H31Cl2N2O4+ — CID 166087080
1-[[[1-[(2Z,4Z)-2-chlorohepta-2,4,6-trien-3-yl]-2-oxocyclohexyl]-methylamino]methoxymethyl]pyridin-1-ium-3-carboxylic acid;chloromethane (PubChem CID 166087080) has the molecular formula C23H31Cl2N2O4+ and a molecular weight of 470.42 g/mol. Its IUPAC name is 1-[[[1-[(2Z,4Z)-2-chlorohepta-2,4,6-trien-3-yl]-2-oxocyclohexyl]-methylamino]methoxymethyl]pyridin-1-ium-3-carboxylic acid;chloromethane.
| Compound Name | 1-[[[1-[(2Z,4Z)-2-chlorohepta-2,4,6-trien-3-yl]-2-oxocyclohexyl]-methylamino]methoxymethyl]pyridin-1-ium-3-carboxylic acid;chloromethane |
|---|---|
| PubChem CID | 166087080 |
| Molecular Formula | C23H31Cl2N2O4+ |
| Molecular Weight | 470.42 g/mol |
| Exact Mass | 469.17 |
| IUPAC Name | 1-[[[1-[(2Z,4Z)-2-chlorohepta-2,4,6-trien-3-yl]-2-oxocyclohexyl]-methylamino]methoxymethyl]pyridin-1-ium-3-carboxylic acid;chloromethane |
| SMILES | C=C/C=C\C(=C(/C)Cl)C1(N(C)COC[n+]2cccc(C(=O)O)c2)CCCCC1=O.CCl |
| InChI | InChI=1S/C22H27ClN2O4.CH3Cl/c1-4-5-10-19(17(2)23)22(12-7-6-11-20(22)26)24(3)15-29-16-25-13-8-9-18(14-25)21(27)28;1-2/h4-5,8-10,13-14H,1,6-7,11-12,15-16H2,2-3H3;1H3/p+1/b10-5-,19-17-; |
| InChIKey | JBPLNDKZVXKSBE-BHLQXGOLSA-O |
| XLogP | 4.53 |
| TPSA | 70.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.42 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|