C17H17BrN2O3 — CID 166087816
ethyl 5-[(6-bromo-2-pyridinyl)oxymethyl]-1,3-dihydroisoindole-2-carboxylate (PubChem CID 166087816) has the molecular formula C17H17BrN2O3 and a molecular weight of 377.24 g/mol. Its IUPAC name is ethyl 5-[(6-bromo-2-pyridinyl)oxymethyl]-1,3-dihydroisoindole-2-carboxylate.
| Compound Name | ethyl 5-[(6-bromo-2-pyridinyl)oxymethyl]-1,3-dihydroisoindole-2-carboxylate |
|---|---|
| PubChem CID | 166087816 |
| Molecular Formula | C17H17BrN2O3 |
| Molecular Weight | 377.24 g/mol |
| Exact Mass | 376.04 |
| IUPAC Name | ethyl 5-[(6-bromo-2-pyridinyl)oxymethyl]-1,3-dihydroisoindole-2-carboxylate |
| SMILES | CCOC(=O)N1Cc2ccc(COc3cccc(Br)n3)cc2C1 |
| InChI | InChI=1S/C17H17BrN2O3/c1-2-22-17(21)20-9-13-7-6-12(8-14(13)10-20)11-23-16-5-3-4-15(18)19-16/h3-8H,2,9-11H2,1H3 |
| InChIKey | LHLKXWMVJJPBBF-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.24 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|