C15H23N3OS — CID 166087998
2-butan-2-yl-5-[1-(oxetan-3-yl)pyrazol-4-yl]-1,3-thiazole;ethane (PubChem CID 166087998) has the molecular formula C15H23N3OS and a molecular weight of 293.44 g/mol. Its IUPAC name is 2-butan-2-yl-5-[1-(oxetan-3-yl)pyrazol-4-yl]-1,3-thiazole;ethane.
| Compound Name | 2-butan-2-yl-5-[1-(oxetan-3-yl)pyrazol-4-yl]-1,3-thiazole;ethane |
|---|---|
| PubChem CID | 166087998 |
| Molecular Formula | C15H23N3OS |
| Molecular Weight | 293.44 g/mol |
| Exact Mass | 293.16 |
| IUPAC Name | 2-butan-2-yl-5-[1-(oxetan-3-yl)pyrazol-4-yl]-1,3-thiazole;ethane |
| SMILES | CC.CCC(C)c1ncc(-c2cnn(C3COC3)c2)s1 |
| InChI | InChI=1S/C13H17N3OS.C2H6/c1-3-9(2)13-14-5-12(18-13)10-4-15-16(6-10)11-7-17-8-11;1-2/h4-6,9,11H,3,7-8H2,1-2H3;1-2H3 |
| InChIKey | CZWRAEMSGKULOE-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.44 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |