About 5-chloro-2-propan-2-yl-1,3-thiazole;ethane
5-chloro-2-propan-2-yl-1,3-thiazole;ethane (PubChem CID 166088238) has the molecular formula C8H14ClNS
and a molecular weight of 191.73 g/mol. Its IUPAC name is 5-chloro-2-propan-2-yl-1,3-thiazole;ethane.
Molecular Properties
| Compound Name | 5-chloro-2-propan-2-yl-1,3-thiazole;ethane |
| PubChem CID | 166088238 |
| Molecular Formula | C8H14ClNS |
| Molecular Weight | 191.73 g/mol |
| Exact Mass | 191.05 |
| IUPAC Name | 5-chloro-2-propan-2-yl-1,3-thiazole;ethane |
| SMILES | CC.CC(C)c1ncc(Cl)s1 |
| InChI | InChI=1S/C6H8ClNS.C2H6/c1-4(2)6-8-3-5(7)9-6;1-2/h3-4H,1-2H3;1-2H3 |
| InChIKey | MCGMZGMSUUBFAJ-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.73 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-chloro-2-propan-2-yl-1,3-thiazole;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-2-propan-2-yl-1,3-thiazole;ethane?
The IUPAC name of 5-chloro-2-propan-2-yl-1,3-thiazole;ethane (CID 166088238) is 5-chloro-2-propan-2-yl-1,3-thiazole;ethane.
What is the SMILES notation for 5-chloro-2-propan-2-yl-1,3-thiazole;ethane?
The canonical SMILES for 5-chloro-2-propan-2-yl-1,3-thiazole;ethane is CC.CC(C)c1ncc(Cl)s1.
What is the InChIKey of 5-chloro-2-propan-2-yl-1,3-thiazole;ethane?
The InChIKey is MCGMZGMSUUBFAJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8ClNS.C2H6/c1-4(2)6-8-3-5(7)9-6;1-2/h3-4H,1-2H3;1-2H3.
What are the key properties of 5-chloro-2-propan-2-yl-1,3-thiazole;ethane?
5-chloro-2-propan-2-yl-1,3-thiazole;ethane has a molecular weight of 191.73 g/mol, XLogP of 3.95, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-2-propan-2-yl-1,3-thiazole;ethane is sourced from PubChem (CID 166088238), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).