About ethane;[5-(trifluoromethyl)-1,3-thiazol-2-yl]methanol
ethane;[5-(trifluoromethyl)-1,3-thiazol-2-yl]methanol (PubChem CID 166088272) has the molecular formula C9H16F3NOS
and a molecular weight of 243.29 g/mol. Its IUPAC name is ethane;[5-(trifluoromethyl)-1,3-thiazol-2-yl]methanol.
Molecular Properties
| Compound Name | ethane;[5-(trifluoromethyl)-1,3-thiazol-2-yl]methanol |
| PubChem CID | 166088272 |
| Molecular Formula | C9H16F3NOS |
| Molecular Weight | 243.29 g/mol |
| Exact Mass | 243.09 |
| IUPAC Name | ethane;[5-(trifluoromethyl)-1,3-thiazol-2-yl]methanol |
| SMILES | CC.CC.OCc1ncc(C(F)(F)F)s1 |
| InChI | InChI=1S/C5H4F3NOS.2C2H6/c6-5(7,8)3-1-9-4(2-10)11-3;2*1-2/h1,10H,2H2;2*1-2H3 |
| InChIKey | PECZOMCWVJQGGR-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.29 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethane;[5-(trifluoromethyl)-1,3-thiazol-2-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;[5-(trifluoromethyl)-1,3-thiazol-2-yl]methanol?
The IUPAC name of ethane;[5-(trifluoromethyl)-1,3-thiazol-2-yl]methanol (CID 166088272) is ethane;[5-(trifluoromethyl)-1,3-thiazol-2-yl]methanol.
What is the SMILES notation for ethane;[5-(trifluoromethyl)-1,3-thiazol-2-yl]methanol?
The canonical SMILES for ethane;[5-(trifluoromethyl)-1,3-thiazol-2-yl]methanol is CC.CC.OCc1ncc(C(F)(F)F)s1.
What is the InChIKey of ethane;[5-(trifluoromethyl)-1,3-thiazol-2-yl]methanol?
The InChIKey is PECZOMCWVJQGGR-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H4F3NOS.2C2H6/c6-5(7,8)3-1-9-4(2-10)11-3;2*1-2/h1,10H,2H2;2*1-2H3.
What are the key properties of ethane;[5-(trifluoromethyl)-1,3-thiazol-2-yl]methanol?
ethane;[5-(trifluoromethyl)-1,3-thiazol-2-yl]methanol has a molecular weight of 243.29 g/mol, XLogP of 3.71, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;[5-(trifluoromethyl)-1,3-thiazol-2-yl]methanol is sourced from PubChem (CID 166088272), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).