C9H16F3NOS — CID 166088272
ethane;[5-(trifluoromethyl)-1,3-thiazol-2-yl]methanol (PubChem CID 166088272) has the molecular formula C9H16F3NOS and a molecular weight of 243.29 g/mol. Its IUPAC name is ethane;[5-(trifluoromethyl)-1,3-thiazol-2-yl]methanol.
| Compound Name | ethane;[5-(trifluoromethyl)-1,3-thiazol-2-yl]methanol |
|---|---|
| PubChem CID | 166088272 |
| Molecular Formula | C9H16F3NOS |
| Molecular Weight | 243.29 g/mol |
| Exact Mass | 243.09 |
| IUPAC Name | ethane;[5-(trifluoromethyl)-1,3-thiazol-2-yl]methanol |
| SMILES | CC.CC.OCc1ncc(C(F)(F)F)s1 |
| InChI | InChI=1S/C5H4F3NOS.2C2H6/c6-5(7,8)3-1-9-4(2-10)11-3;2*1-2/h1,10H,2H2;2*1-2H3 |
| InChIKey | PECZOMCWVJQGGR-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.29 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |