C23H25N7O — CID 166088870
3-ethyl-7-[[4-[4-(1,2,4-triazol-4-yl)phenyl]piperazin-1-yl]methyl]-1H-1,5-naphthyridin-2-one (PubChem CID 166088870) has the molecular formula C23H25N7O and a molecular weight of 415.50 g/mol. Its IUPAC name is 3-ethyl-7-[[4-[4-(1,2,4-triazol-4-yl)phenyl]piperazin-1-yl]methyl]-1H-1,5-naphthyridin-2-one.
| Compound Name | 3-ethyl-7-[[4-[4-(1,2,4-triazol-4-yl)phenyl]piperazin-1-yl]methyl]-1H-1,5-naphthyridin-2-one |
|---|---|
| PubChem CID | 166088870 |
| Molecular Formula | C23H25N7O |
| Molecular Weight | 415.50 g/mol |
| Exact Mass | 415.21 |
| IUPAC Name | 3-ethyl-7-[[4-[4-(1,2,4-triazol-4-yl)phenyl]piperazin-1-yl]methyl]-1H-1,5-naphthyridin-2-one |
| SMILES | CCc1cc2ncc(CN3CCN(c4ccc(-n5cnnc5)cc4)CC3)cc2[nH]c1=O |
| InChI | InChI=1S/C23H25N7O/c1-2-18-12-21-22(27-23(18)31)11-17(13-24-21)14-28-7-9-29(10-8-28)19-3-5-20(6-4-19)30-15-25-26-16-30/h3-6,11-13,15-16H,2,7-10,14H2,1H3,(H,27,31) |
| InChIKey | MGEQYNSCHXQCCB-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 82.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.50 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|