About 2-[4-[6-[(4-chloro-2-fluorophenyl)methoxy]-5-fluoro-2-pyridinyl]-2,5-difluorophenyl]acetic acid
2-[4-[6-[(4-chloro-2-fluorophenyl)methoxy]-5-fluoro-2-pyridinyl]-2,5-difluorophenyl]acetic acid (PubChem CID 166089368) has the molecular formula C20H12ClF4NO3
and a molecular weight of 425.77 g/mol. Its IUPAC name is 2-[4-[6-[(4-chloro-2-fluorophenyl)methoxy]-5-fluoro-2-pyridinyl]-2,5-difluorophenyl]acetic acid.
Molecular Properties
| Compound Name | 2-[4-[6-[(4-chloro-2-fluorophenyl)methoxy]-5-fluoro-2-pyridinyl]-2,5-difluorophenyl]acetic acid |
| PubChem CID | 166089368 |
| Molecular Formula | C20H12ClF4NO3 |
| Molecular Weight | 425.77 g/mol |
| Exact Mass | 425.04 |
| IUPAC Name | 2-[4-[6-[(4-chloro-2-fluorophenyl)methoxy]-5-fluoro-2-pyridinyl]-2,5-difluorophenyl]acetic acid |
| SMILES | O=C(O)Cc1cc(F)c(-c2ccc(F)c(OCc3ccc(Cl)cc3F)n2)cc1F |
| InChI | InChI=1S/C20H12ClF4NO3/c21-12-2-1-10(15(23)7-12)9-29-20-14(22)3-4-18(26-20)13-8-16(24)11(5-17(13)25)6-19(27)28/h1-5,7-8H,6,9H2,(H,27,28) |
| InChIKey | NNQGLUPHJCNTAZ-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 425.77 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[4-[6-[(4-chloro-2-fluorophenyl)methoxy]-5-fluoro-2-pyridinyl]-2,5-difluorophenyl]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-[6-[(4-chloro-2-fluorophenyl)methoxy]-5-fluoro-2-pyridinyl]-2,5-difluorophenyl]acetic acid?
The IUPAC name of 2-[4-[6-[(4-chloro-2-fluorophenyl)methoxy]-5-fluoro-2-pyridinyl]-2,5-difluorophenyl]acetic acid (CID 166089368) is 2-[4-[6-[(4-chloro-2-fluorophenyl)methoxy]-5-fluoro-2-pyridinyl]-2,5-difluorophenyl]acetic acid.
What is the SMILES notation for 2-[4-[6-[(4-chloro-2-fluorophenyl)methoxy]-5-fluoro-2-pyridinyl]-2,5-difluorophenyl]acetic acid?
The canonical SMILES for 2-[4-[6-[(4-chloro-2-fluorophenyl)methoxy]-5-fluoro-2-pyridinyl]-2,5-difluorophenyl]acetic acid is O=C(O)Cc1cc(F)c(-c2ccc(F)c(OCc3ccc(Cl)cc3F)n2)cc1F.
What is the InChIKey of 2-[4-[6-[(4-chloro-2-fluorophenyl)methoxy]-5-fluoro-2-pyridinyl]-2,5-difluorophenyl]acetic acid?
The InChIKey is NNQGLUPHJCNTAZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H12ClF4NO3/c21-12-2-1-10(15(23)7-12)9-29-20-14(22)3-4-18(26-20)13-8-16(24)11(5-17(13)25)6-19(27)28/h1-5,7-8H,6,9H2,(H,27,28).
What are the key properties of 2-[4-[6-[(4-chloro-2-fluorophenyl)methoxy]-5-fluoro-2-pyridinyl]-2,5-difluorophenyl]acetic acid?
2-[4-[6-[(4-chloro-2-fluorophenyl)methoxy]-5-fluoro-2-pyridinyl]-2,5-difluorophenyl]acetic acid has a molecular weight of 425.77 g/mol, XLogP of 5.16, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-[6-[(4-chloro-2-fluorophenyl)methoxy]-5-fluoro-2-pyridinyl]-2,5-difluorophenyl]acetic acid is sourced from PubChem (CID 166089368), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).