C25H33FN6O2 — CID 166090660
5-fluoro-N-[4-(4-methylpiperazin-1-yl)-3-propan-2-yloxyphenyl]-7-(oxolan-2-ylmethyl)pyrrolo[2,3-d]pyrimidin-2-amine (PubChem CID 166090660) has the molecular formula C25H33FN6O2 and a molecular weight of 468.58 g/mol. Its IUPAC name is 5-fluoro-N-[4-(4-methylpiperazin-1-yl)-3-propan-2-yloxyphenyl]-7-(oxolan-2-ylmethyl)pyrrolo[2,3-d]pyrimidin-2-amine.
| Compound Name | 5-fluoro-N-[4-(4-methylpiperazin-1-yl)-3-propan-2-yloxyphenyl]-7-(oxolan-2-ylmethyl)pyrrolo[2,3-d]pyrimidin-2-amine |
|---|---|
| PubChem CID | 166090660 |
| Molecular Formula | C25H33FN6O2 |
| Molecular Weight | 468.58 g/mol |
| Exact Mass | 468.26 |
| IUPAC Name | 5-fluoro-N-[4-(4-methylpiperazin-1-yl)-3-propan-2-yloxyphenyl]-7-(oxolan-2-ylmethyl)pyrrolo[2,3-d]pyrimidin-2-amine |
| SMILES | CC(C)Oc1cc(Nc2ncc3c(F)cn(CC4CCCO4)c3n2)ccc1N1CCN(C)CC1 |
| InChI | InChI=1S/C25H33FN6O2/c1-17(2)34-23-13-18(6-7-22(23)31-10-8-30(3)9-11-31)28-25-27-14-20-21(26)16-32(24(20)29-25)15-19-5-4-12-33-19/h6-7,13-14,16-17,19H,4-5,8-12,15H2,1-3H3,(H,27,28,29) |
| InChIKey | QQIFHLHMOXVJPC-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 67.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.58 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|