C27H31ClFN3O4S — CID 166090972
(2Z)-3-[[4-[2-(3-chloro-5-cyano-4-propoxyphenyl)propan-2-yl]phenoxy]methyl]-2-fluoro-N'-methyl-N-methylsulfonylpenta-2,4-dienimidamide (PubChem CID 166090972) has the molecular formula C27H31ClFN3O4S and a molecular weight of 548.08 g/mol. Its IUPAC name is (2Z)-3-[[4-[2-(3-chloro-5-cyano-4-propoxyphenyl)propan-2-yl]phenoxy]methyl]-2-fluoro-N'-methyl-N-methylsulfonylpenta-2,4-dienimidamide.
| Compound Name | (2Z)-3-[[4-[2-(3-chloro-5-cyano-4-propoxyphenyl)propan-2-yl]phenoxy]methyl]-2-fluoro-N'-methyl-N-methylsulfonylpenta-2,4-dienimidamide |
|---|---|
| PubChem CID | 166090972 |
| Molecular Formula | C27H31ClFN3O4S |
| Molecular Weight | 548.08 g/mol |
| Exact Mass | 547.17 |
| IUPAC Name | (2Z)-3-[[4-[2-(3-chloro-5-cyano-4-propoxyphenyl)propan-2-yl]phenoxy]methyl]-2-fluoro-N'-methyl-N-methylsulfonylpenta-2,4-dienimidamide |
| SMILES | C=C/C(COc1ccc(C(C)(C)c2cc(Cl)c(OCCC)c(C#N)c2)cc1)=C(F)\C(=N\C)NS(C)(=O)=O |
| InChI | InChI=1S/C27H31ClFN3O4S/c1-7-13-35-25-19(16-30)14-21(15-23(25)28)27(3,4)20-9-11-22(12-10-20)36-17-18(8-2)24(29)26(31-5)32-37(6,33)34/h8-12,14-15H,2,7,13,17H2,1,3-6H3,(H,31,32)/b24-18- |
| InChIKey | GBVJEMRRWHNCFD-MOHJPFBDSA-N |
| XLogP | 5.69 |
| TPSA | 100.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.08 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|