C25H33NO2 — CID 166090976
3-methyl-5-[2-(4-pentan-2-yloxyphenyl)propan-2-yl]-2-propoxybenzonitrile (PubChem CID 166090976) has the molecular formula C25H33NO2 and a molecular weight of 379.54 g/mol. Its IUPAC name is 3-methyl-5-[2-(4-pentan-2-yloxyphenyl)propan-2-yl]-2-propoxybenzonitrile.
| Compound Name | 3-methyl-5-[2-(4-pentan-2-yloxyphenyl)propan-2-yl]-2-propoxybenzonitrile |
|---|---|
| PubChem CID | 166090976 |
| Molecular Formula | C25H33NO2 |
| Molecular Weight | 379.54 g/mol |
| Exact Mass | 379.25 |
| IUPAC Name | 3-methyl-5-[2-(4-pentan-2-yloxyphenyl)propan-2-yl]-2-propoxybenzonitrile |
| SMILES | CCCOc1c(C)cc(C(C)(C)c2ccc(OC(C)CCC)cc2)cc1C#N |
| InChI | InChI=1S/C25H33NO2/c1-7-9-19(4)28-23-12-10-21(11-13-23)25(5,6)22-15-18(3)24(27-14-8-2)20(16-22)17-26/h10-13,15-16,19H,7-9,14H2,1-6H3 |
| InChIKey | BBFJHEVFBFYSIX-UHFFFAOYSA-N |
| XLogP | 6.55 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.54 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |