About ethane;6-propan-2-yl-1,2-dihydro-1,5-naphthyridine
ethane;6-propan-2-yl-1,2-dihydro-1,5-naphthyridine (PubChem CID 166091221) has the molecular formula C13H20N2
and a molecular weight of 204.32 g/mol. Its IUPAC name is ethane;6-propan-2-yl-1,2-dihydro-1,5-naphthyridine.
Molecular Properties
| Compound Name | ethane;6-propan-2-yl-1,2-dihydro-1,5-naphthyridine |
| PubChem CID | 166091221 |
| Molecular Formula | C13H20N2 |
| Molecular Weight | 204.32 g/mol |
| Exact Mass | 204.16 |
| IUPAC Name | ethane;6-propan-2-yl-1,2-dihydro-1,5-naphthyridine |
| SMILES | CC.CC(C)c1ccc2c(n1)C=CCN2 |
| InChI | InChI=1S/C11H14N2.C2H6/c1-8(2)9-5-6-10-11(13-9)4-3-7-12-10;1-2/h3-6,8,12H,7H2,1-2H3;1-2H3 |
| InChIKey | UUCRFOVASKFIBK-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.32 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethane;6-propan-2-yl-1,2-dihydro-1,5-naphthyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;6-propan-2-yl-1,2-dihydro-1,5-naphthyridine?
The IUPAC name of ethane;6-propan-2-yl-1,2-dihydro-1,5-naphthyridine (CID 166091221) is ethane;6-propan-2-yl-1,2-dihydro-1,5-naphthyridine.
What is the SMILES notation for ethane;6-propan-2-yl-1,2-dihydro-1,5-naphthyridine?
The canonical SMILES for ethane;6-propan-2-yl-1,2-dihydro-1,5-naphthyridine is CC.CC(C)c1ccc2c(n1)C=CCN2.
What is the InChIKey of ethane;6-propan-2-yl-1,2-dihydro-1,5-naphthyridine?
The InChIKey is UUCRFOVASKFIBK-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14N2.C2H6/c1-8(2)9-5-6-10-11(13-9)4-3-7-12-10;1-2/h3-6,8,12H,7H2,1-2H3;1-2H3.
What are the key properties of ethane;6-propan-2-yl-1,2-dihydro-1,5-naphthyridine?
ethane;6-propan-2-yl-1,2-dihydro-1,5-naphthyridine has a molecular weight of 204.32 g/mol, XLogP of 3.67, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;6-propan-2-yl-1,2-dihydro-1,5-naphthyridine is sourced from PubChem (CID 166091221), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).