About 6-nitro-3,4-dihydro-1H-1,8-phenanthrolin-2-one
6-nitro-3,4-dihydro-1H-1,8-phenanthrolin-2-one (PubChem CID 166091414) has the molecular formula C12H9N3O3
and a molecular weight of 243.22 g/mol. Its IUPAC name is 6-nitro-3,4-dihydro-1H-1,8-phenanthrolin-2-one.
Molecular Properties
| Compound Name | 6-nitro-3,4-dihydro-1H-1,8-phenanthrolin-2-one |
| PubChem CID | 166091414 |
| Molecular Formula | C12H9N3O3 |
| Molecular Weight | 243.22 g/mol |
| Exact Mass | 243.06 |
| IUPAC Name | 6-nitro-3,4-dihydro-1H-1,8-phenanthrolin-2-one |
| SMILES | O=C1CCc2cc([N+](=O)[O-])c3cnccc3c2N1 |
| InChI | InChI=1S/C12H9N3O3/c16-11-2-1-7-5-10(15(17)18)9-6-13-4-3-8(9)12(7)14-11/h3-6H,1-2H2,(H,14,16) |
| InChIKey | ICJJAOZOBZOMRU-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 85.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.22 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 6-nitro-3,4-dihydro-1H-1,8-phenanthrolin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-nitro-3,4-dihydro-1H-1,8-phenanthrolin-2-one?
The IUPAC name of 6-nitro-3,4-dihydro-1H-1,8-phenanthrolin-2-one (CID 166091414) is 6-nitro-3,4-dihydro-1H-1,8-phenanthrolin-2-one.
What is the SMILES notation for 6-nitro-3,4-dihydro-1H-1,8-phenanthrolin-2-one?
The canonical SMILES for 6-nitro-3,4-dihydro-1H-1,8-phenanthrolin-2-one is O=C1CCc2cc([N+](=O)[O-])c3cnccc3c2N1.
What is the InChIKey of 6-nitro-3,4-dihydro-1H-1,8-phenanthrolin-2-one?
The InChIKey is ICJJAOZOBZOMRU-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H9N3O3/c16-11-2-1-7-5-10(15(17)18)9-6-13-4-3-8(9)12(7)14-11/h3-6H,1-2H2,(H,14,16).
What are the key properties of 6-nitro-3,4-dihydro-1H-1,8-phenanthrolin-2-one?
6-nitro-3,4-dihydro-1H-1,8-phenanthrolin-2-one has a molecular weight of 243.22 g/mol, XLogP of 2.03, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-nitro-3,4-dihydro-1H-1,8-phenanthrolin-2-one is sourced from PubChem (CID 166091414), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).