C19H18ClF3N2O2 — CID 166091593
(2E)-N-(8-chloro-2-oxo-3,4-dihydro-1H-quinolin-6-yl)-2-[(Z)-prop-1-enyl]-3-(2,2,2-trifluoroethyl)penta-2,4-dienamide (PubChem CID 166091593) has the molecular formula C19H18ClF3N2O2 and a molecular weight of 398.81 g/mol. Its IUPAC name is (2E)-N-(8-chloro-2-oxo-3,4-dihydro-1H-quinolin-6-yl)-2-[(Z)-prop-1-enyl]-3-(2,2,2-trifluoroethyl)penta-2,4-dienamide.
| Compound Name | (2E)-N-(8-chloro-2-oxo-3,4-dihydro-1H-quinolin-6-yl)-2-[(Z)-prop-1-enyl]-3-(2,2,2-trifluoroethyl)penta-2,4-dienamide |
|---|---|
| PubChem CID | 166091593 |
| Molecular Formula | C19H18ClF3N2O2 |
| Molecular Weight | 398.81 g/mol |
| Exact Mass | 398.10 |
| IUPAC Name | (2E)-N-(8-chloro-2-oxo-3,4-dihydro-1H-quinolin-6-yl)-2-[(Z)-prop-1-enyl]-3-(2,2,2-trifluoroethyl)penta-2,4-dienamide |
| SMILES | C=C/C(CC(F)(F)F)=C(\C=C/C)C(=O)Nc1cc(Cl)c2c(c1)CCC(=O)N2 |
| InChI | InChI=1S/C19H18ClF3N2O2/c1-3-5-14(11(4-2)10-19(21,22)23)18(27)24-13-8-12-6-7-16(26)25-17(12)15(20)9-13/h3-5,8-9H,2,6-7,10H2,1H3,(H,24,27)(H,25,26)/b5-3-,14-11- |
| InChIKey | WJSQRLPZVXJNRS-CISMGOILSA-N |
| XLogP | 5.17 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.81 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|