About 6-tert-butylspiro[1,4-dihydroquinoline-3,1'-cyclopropane]-2-one
6-tert-butylspiro[1,4-dihydroquinoline-3,1'-cyclopropane]-2-one (PubChem CID 166091607) has the molecular formula C15H19NO
and a molecular weight of 229.32 g/mol. Its IUPAC name is 6-tert-butylspiro[1,4-dihydroquinoline-3,1'-cyclopropane]-2-one.
Molecular Properties
| Compound Name | 6-tert-butylspiro[1,4-dihydroquinoline-3,1'-cyclopropane]-2-one |
| PubChem CID | 166091607 |
| Molecular Formula | C15H19NO |
| Molecular Weight | 229.32 g/mol |
| Exact Mass | 229.15 |
| IUPAC Name | 6-tert-butylspiro[1,4-dihydroquinoline-3,1'-cyclopropane]-2-one |
| SMILES | CC(C)(C)c1ccc2c(c1)CC1(CC1)C(=O)N2 |
| InChI | InChI=1S/C15H19NO/c1-14(2,3)11-4-5-12-10(8-11)9-15(6-7-15)13(17)16-12/h4-5,8H,6-7,9H2,1-3H3,(H,16,17) |
| InChIKey | WLCWVXWJXUFWSV-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.32 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 6-tert-butylspiro[1,4-dihydroquinoline-3,1'-cyclopropane]-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-tert-butylspiro[1,4-dihydroquinoline-3,1'-cyclopropane]-2-one?
The IUPAC name of 6-tert-butylspiro[1,4-dihydroquinoline-3,1'-cyclopropane]-2-one (CID 166091607) is 6-tert-butylspiro[1,4-dihydroquinoline-3,1'-cyclopropane]-2-one.
What is the SMILES notation for 6-tert-butylspiro[1,4-dihydroquinoline-3,1'-cyclopropane]-2-one?
The canonical SMILES for 6-tert-butylspiro[1,4-dihydroquinoline-3,1'-cyclopropane]-2-one is CC(C)(C)c1ccc2c(c1)CC1(CC1)C(=O)N2.
What is the InChIKey of 6-tert-butylspiro[1,4-dihydroquinoline-3,1'-cyclopropane]-2-one?
The InChIKey is WLCWVXWJXUFWSV-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H19NO/c1-14(2,3)11-4-5-12-10(8-11)9-15(6-7-15)13(17)16-12/h4-5,8H,6-7,9H2,1-3H3,(H,16,17).
What are the key properties of 6-tert-butylspiro[1,4-dihydroquinoline-3,1'-cyclopropane]-2-one?
6-tert-butylspiro[1,4-dihydroquinoline-3,1'-cyclopropane]-2-one has a molecular weight of 229.32 g/mol, XLogP of 3.26, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-tert-butylspiro[1,4-dihydroquinoline-3,1'-cyclopropane]-2-one is sourced from PubChem (CID 166091607), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).