C20H20F4N2O2 — CID 166091650
(E)-N-(7,8-difluoro-2-oxo-3,4-dihydro-1H-quinolin-6-yl)-3-ethenyl-5,5-difluoro-2-[(Z)-prop-1-enyl]hex-2-enamide (PubChem CID 166091650) has the molecular formula C20H20F4N2O2 and a molecular weight of 396.38 g/mol. Its IUPAC name is (E)-N-(7,8-difluoro-2-oxo-3,4-dihydro-1H-quinolin-6-yl)-3-ethenyl-5,5-difluoro-2-[(Z)-prop-1-enyl]hex-2-enamide.
| Compound Name | (E)-N-(7,8-difluoro-2-oxo-3,4-dihydro-1H-quinolin-6-yl)-3-ethenyl-5,5-difluoro-2-[(Z)-prop-1-enyl]hex-2-enamide |
|---|---|
| PubChem CID | 166091650 |
| Molecular Formula | C20H20F4N2O2 |
| Molecular Weight | 396.38 g/mol |
| Exact Mass | 396.15 |
| IUPAC Name | (E)-N-(7,8-difluoro-2-oxo-3,4-dihydro-1H-quinolin-6-yl)-3-ethenyl-5,5-difluoro-2-[(Z)-prop-1-enyl]hex-2-enamide |
| SMILES | C=C/C(CC(C)(F)F)=C(\C=C/C)C(=O)Nc1cc2c(c(F)c1F)NC(=O)CC2 |
| InChI | InChI=1S/C20H20F4N2O2/c1-4-6-13(11(5-2)10-20(3,23)24)19(28)25-14-9-12-7-8-15(27)26-18(12)17(22)16(14)21/h4-6,9H,2,7-8,10H2,1,3H3,(H,25,28)(H,26,27)/b6-4-,13-11- |
| InChIKey | ATVPRHBOFUSHTB-NHDWVQLVSA-N |
| XLogP | 4.89 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.38 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|