C28H33N3O2 — CID 166091946
(6aR,9R)-N,N-diethyl-7-[2-(4-methoxyphenyl)ethyl]-6,6a,8,9-tetrahydro-4H-indolo[4,3-fg]quinoline-9-carboxamide (PubChem CID 166091946) has the molecular formula C28H33N3O2 and a molecular weight of 443.59 g/mol. Its IUPAC name is (6aR,9R)-N,N-diethyl-7-[2-(4-methoxyphenyl)ethyl]-6,6a,8,9-tetrahydro-4H-indolo[4,3-fg]quinoline-9-carboxamide.
| Compound Name | (6aR,9R)-N,N-diethyl-7-[2-(4-methoxyphenyl)ethyl]-6,6a,8,9-tetrahydro-4H-indolo[4,3-fg]quinoline-9-carboxamide |
|---|---|
| PubChem CID | 166091946 |
| Molecular Formula | C28H33N3O2 |
| Molecular Weight | 443.59 g/mol |
| Exact Mass | 443.26 |
| IUPAC Name | (6aR,9R)-N,N-diethyl-7-[2-(4-methoxyphenyl)ethyl]-6,6a,8,9-tetrahydro-4H-indolo[4,3-fg]quinoline-9-carboxamide |
| SMILES | CCN(CC)C(=O)[C@@H]1C=C2c3cccc4[nH]cc(c34)C[C@H]2N(CCc2ccc(OC)cc2)C1 |
| InChI | InChI=1S/C28H33N3O2/c1-4-30(5-2)28(32)21-15-24-23-7-6-8-25-27(23)20(17-29-25)16-26(24)31(18-21)14-13-19-9-11-22(33-3)12-10-19/h6-12,15,17,21,26,29H,4-5,13-14,16,18H2,1-3H3/t21-,26-/m1/s1 |
| InChIKey | NILLLSKBSIRXLX-QFQXNSOFSA-N |
| XLogP | 4.53 |
| TPSA | 48.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.59 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |