C31H33NO — CID 166092039
(9S,13S,16R)-9-benzyl-13-methyl-3-(2-methyl-3-pyridinyl)-7,11,12,15,16,17-hexahydro-6H-cyclopenta[a]phenanthren-16-ol (PubChem CID 166092039) has the molecular formula C31H33NO and a molecular weight of 435.61 g/mol. Its IUPAC name is (9S,13S,16R)-9-benzyl-13-methyl-3-(2-methyl-3-pyridinyl)-7,11,12,15,16,17-hexahydro-6H-cyclopenta[a]phenanthren-16-ol.
| Compound Name | (9S,13S,16R)-9-benzyl-13-methyl-3-(2-methyl-3-pyridinyl)-7,11,12,15,16,17-hexahydro-6H-cyclopenta[a]phenanthren-16-ol |
|---|---|
| PubChem CID | 166092039 |
| Molecular Formula | C31H33NO |
| Molecular Weight | 435.61 g/mol |
| Exact Mass | 435.26 |
| IUPAC Name | (9S,13S,16R)-9-benzyl-13-methyl-3-(2-methyl-3-pyridinyl)-7,11,12,15,16,17-hexahydro-6H-cyclopenta[a]phenanthren-16-ol |
| SMILES | Cc1ncccc1-c1ccc2c(c1)CCC1=C3C[C@H](O)C[C@]3(C)CC[C@]12Cc1ccccc1 |
| InChI | InChI=1S/C31H33NO/c1-21-26(9-6-16-32-21)23-10-12-27-24(17-23)11-13-28-29-18-25(33)20-30(29,2)14-15-31(27,28)19-22-7-4-3-5-8-22/h3-10,12,16-17,25,33H,11,13-15,18-20H2,1-2H3/t25-,30-,31+/m0/s1 |
| InChIKey | XJDULFYOLTZQHD-LGXAAPQCSA-N |
| XLogP | 6.74 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.61 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|