About ethane;1-ethyl-4-methylpiperazine;4-methyloxane
ethane;1-ethyl-4-methylpiperazine;4-methyloxane (PubChem CID 166092256) has the molecular formula C15H34N2O
and a molecular weight of 258.45 g/mol. Its IUPAC name is ethane;1-ethyl-4-methylpiperazine;4-methyloxane.
Molecular Properties
| Compound Name | ethane;1-ethyl-4-methylpiperazine;4-methyloxane |
| PubChem CID | 166092256 |
| Molecular Formula | C15H34N2O |
| Molecular Weight | 258.45 g/mol |
| Exact Mass | 258.27 |
| IUPAC Name | ethane;1-ethyl-4-methylpiperazine;4-methyloxane |
| SMILES | CC.CC1CCOCC1.CCN1CCN(C)CC1 |
| InChI | InChI=1S/C7H16N2.C6H12O.C2H6/c1-3-9-6-4-8(2)5-7-9;1-6-2-4-7-5-3-6;1-2/h3-7H2,1-2H3;6H,2-5H2,1H3;1-2H3 |
| InChIKey | BVMJVNVHMWLWEU-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.45 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethane;1-ethyl-4-methylpiperazine;4-methyloxane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;1-ethyl-4-methylpiperazine;4-methyloxane?
The IUPAC name of ethane;1-ethyl-4-methylpiperazine;4-methyloxane (CID 166092256) is ethane;1-ethyl-4-methylpiperazine;4-methyloxane.
What is the SMILES notation for ethane;1-ethyl-4-methylpiperazine;4-methyloxane?
The canonical SMILES for ethane;1-ethyl-4-methylpiperazine;4-methyloxane is CC.CC1CCOCC1.CCN1CCN(C)CC1.
What is the InChIKey of ethane;1-ethyl-4-methylpiperazine;4-methyloxane?
The InChIKey is BVMJVNVHMWLWEU-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H16N2.C6H12O.C2H6/c1-3-9-6-4-8(2)5-7-9;1-6-2-4-7-5-3-6;1-2/h3-7H2,1-2H3;6H,2-5H2,1H3;1-2H3.
What are the key properties of ethane;1-ethyl-4-methylpiperazine;4-methyloxane?
ethane;1-ethyl-4-methylpiperazine;4-methyloxane has a molecular weight of 258.45 g/mol, XLogP of 2.71, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;1-ethyl-4-methylpiperazine;4-methyloxane is sourced from PubChem (CID 166092256), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).