About 6-bromo-4,7-difluoro-3-methyl-2H-isoquinolin-1-one
6-bromo-4,7-difluoro-3-methyl-2H-isoquinolin-1-one (PubChem CID 166092288) has the molecular formula C10H6BrF2NO
and a molecular weight of 274.06 g/mol. Its IUPAC name is 6-bromo-4,7-difluoro-3-methyl-2H-isoquinolin-1-one.
Molecular Properties
| Compound Name | 6-bromo-4,7-difluoro-3-methyl-2H-isoquinolin-1-one |
| PubChem CID | 166092288 |
| Molecular Formula | C10H6BrF2NO |
| Molecular Weight | 274.06 g/mol |
| Exact Mass | 272.96 |
| IUPAC Name | 6-bromo-4,7-difluoro-3-methyl-2H-isoquinolin-1-one |
| SMILES | Cc1[nH]c(=O)c2cc(F)c(Br)cc2c1F |
| InChI | InChI=1S/C10H6BrF2NO/c1-4-9(13)5-2-7(11)8(12)3-6(5)10(15)14-4/h2-3H,1H3,(H,14,15) |
| InChIKey | PTSBSIPCXABQFJ-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.06 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 6-bromo-4,7-difluoro-3-methyl-2H-isoquinolin-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-bromo-4,7-difluoro-3-methyl-2H-isoquinolin-1-one?
The IUPAC name of 6-bromo-4,7-difluoro-3-methyl-2H-isoquinolin-1-one (CID 166092288) is 6-bromo-4,7-difluoro-3-methyl-2H-isoquinolin-1-one.
What is the SMILES notation for 6-bromo-4,7-difluoro-3-methyl-2H-isoquinolin-1-one?
The canonical SMILES for 6-bromo-4,7-difluoro-3-methyl-2H-isoquinolin-1-one is Cc1[nH]c(=O)c2cc(F)c(Br)cc2c1F.
What is the InChIKey of 6-bromo-4,7-difluoro-3-methyl-2H-isoquinolin-1-one?
The InChIKey is PTSBSIPCXABQFJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H6BrF2NO/c1-4-9(13)5-2-7(11)8(12)3-6(5)10(15)14-4/h2-3H,1H3,(H,14,15).
What are the key properties of 6-bromo-4,7-difluoro-3-methyl-2H-isoquinolin-1-one?
6-bromo-4,7-difluoro-3-methyl-2H-isoquinolin-1-one has a molecular weight of 274.06 g/mol, XLogP of 2.88, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromo-4,7-difluoro-3-methyl-2H-isoquinolin-1-one is sourced from PubChem (CID 166092288), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).