C22H19F2N5O2 — CID 166092378
6-[3-amino-6-[3-[(dimethylamino)methyl]-4-hydroxyphenyl]-5-fluoropyrazin-2-yl]-4-fluoro-2H-isoquinolin-1-one (PubChem CID 166092378) has the molecular formula C22H19F2N5O2 and a molecular weight of 423.42 g/mol. Its IUPAC name is 6-[3-amino-6-[3-[(dimethylamino)methyl]-4-hydroxyphenyl]-5-fluoropyrazin-2-yl]-4-fluoro-2H-isoquinolin-1-one.
| Compound Name | 6-[3-amino-6-[3-[(dimethylamino)methyl]-4-hydroxyphenyl]-5-fluoropyrazin-2-yl]-4-fluoro-2H-isoquinolin-1-one |
|---|---|
| PubChem CID | 166092378 |
| Molecular Formula | C22H19F2N5O2 |
| Molecular Weight | 423.42 g/mol |
| Exact Mass | 423.15 |
| IUPAC Name | 6-[3-amino-6-[3-[(dimethylamino)methyl]-4-hydroxyphenyl]-5-fluoropyrazin-2-yl]-4-fluoro-2H-isoquinolin-1-one |
| SMILES | CN(C)Cc1cc(-c2nc(-c3ccc4c(=O)[nH]cc(F)c4c3)c(N)nc2F)ccc1O |
| InChI | InChI=1S/C22H19F2N5O2/c1-29(2)10-13-7-11(4-6-17(13)30)18-20(24)28-21(25)19(27-18)12-3-5-14-15(8-12)16(23)9-26-22(14)31/h3-9,30H,10H2,1-2H3,(H2,25,28)(H,26,31) |
| InChIKey | QHBMXEZDDNRTJB-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 108.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.42 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|