About 6-bromo-4,4-difluoro-3-hydroxy-2,3-dihydroisoquinolin-1-one
6-bromo-4,4-difluoro-3-hydroxy-2,3-dihydroisoquinolin-1-one (PubChem CID 166092514) has the molecular formula C9H6BrF2NO2
and a molecular weight of 278.05 g/mol. Its IUPAC name is 6-bromo-4,4-difluoro-3-hydroxy-2,3-dihydroisoquinolin-1-one.
Molecular Properties
| Compound Name | 6-bromo-4,4-difluoro-3-hydroxy-2,3-dihydroisoquinolin-1-one |
| PubChem CID | 166092514 |
| Molecular Formula | C9H6BrF2NO2 |
| Molecular Weight | 278.05 g/mol |
| Exact Mass | 276.95 |
| IUPAC Name | 6-bromo-4,4-difluoro-3-hydroxy-2,3-dihydroisoquinolin-1-one |
| SMILES | O=C1NC(O)C(F)(F)c2cc(Br)ccc21 |
| InChI | InChI=1S/C9H6BrF2NO2/c10-4-1-2-5-6(3-4)9(11,12)8(15)13-7(5)14/h1-3,8,15H,(H,13,14) |
| InChIKey | XMDCONMIVXSUIE-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.05 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-bromo-4,4-difluoro-3-hydroxy-2,3-dihydroisoquinolin-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-bromo-4,4-difluoro-3-hydroxy-2,3-dihydroisoquinolin-1-one?
The IUPAC name of 6-bromo-4,4-difluoro-3-hydroxy-2,3-dihydroisoquinolin-1-one (CID 166092514) is 6-bromo-4,4-difluoro-3-hydroxy-2,3-dihydroisoquinolin-1-one.
What is the SMILES notation for 6-bromo-4,4-difluoro-3-hydroxy-2,3-dihydroisoquinolin-1-one?
The canonical SMILES for 6-bromo-4,4-difluoro-3-hydroxy-2,3-dihydroisoquinolin-1-one is O=C1NC(O)C(F)(F)c2cc(Br)ccc21.
What is the InChIKey of 6-bromo-4,4-difluoro-3-hydroxy-2,3-dihydroisoquinolin-1-one?
The InChIKey is XMDCONMIVXSUIE-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H6BrF2NO2/c10-4-1-2-5-6(3-4)9(11,12)8(15)13-7(5)14/h1-3,8,15H,(H,13,14).
What are the key properties of 6-bromo-4,4-difluoro-3-hydroxy-2,3-dihydroisoquinolin-1-one?
6-bromo-4,4-difluoro-3-hydroxy-2,3-dihydroisoquinolin-1-one has a molecular weight of 278.05 g/mol, XLogP of 1.60, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromo-4,4-difluoro-3-hydroxy-2,3-dihydroisoquinolin-1-one is sourced from PubChem (CID 166092514), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).