About bromobenzene;3-propan-2-yl-3-azabicyclo[3.1.0]hexane
bromobenzene;3-propan-2-yl-3-azabicyclo[3.1.0]hexane (PubChem CID 166093012) has the molecular formula C14H20BrN
and a molecular weight of 282.22 g/mol. Its IUPAC name is bromobenzene;3-propan-2-yl-3-azabicyclo[3.1.0]hexane.
Molecular Properties
| Compound Name | bromobenzene;3-propan-2-yl-3-azabicyclo[3.1.0]hexane |
| PubChem CID | 166093012 |
| Molecular Formula | C14H20BrN |
| Molecular Weight | 282.22 g/mol |
| Exact Mass | 281.08 |
| IUPAC Name | bromobenzene;3-propan-2-yl-3-azabicyclo[3.1.0]hexane |
| SMILES | Brc1ccccc1.CC(C)N1CC2CC2C1 |
| InChI | InChI=1S/C8H15N.C6H5Br/c1-6(2)9-4-7-3-8(7)5-9;7-6-4-2-1-3-5-6/h6-8H,3-5H2,1-2H3;1-5H |
| InChIKey | CWKWOHGUOCREAI-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.22 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze bromobenzene;3-propan-2-yl-3-azabicyclo[3.1.0]hexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bromobenzene;3-propan-2-yl-3-azabicyclo[3.1.0]hexane?
The IUPAC name of bromobenzene;3-propan-2-yl-3-azabicyclo[3.1.0]hexane (CID 166093012) is bromobenzene;3-propan-2-yl-3-azabicyclo[3.1.0]hexane.
What is the SMILES notation for bromobenzene;3-propan-2-yl-3-azabicyclo[3.1.0]hexane?
The canonical SMILES for bromobenzene;3-propan-2-yl-3-azabicyclo[3.1.0]hexane is Brc1ccccc1.CC(C)N1CC2CC2C1.
What is the InChIKey of bromobenzene;3-propan-2-yl-3-azabicyclo[3.1.0]hexane?
The InChIKey is CWKWOHGUOCREAI-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15N.C6H5Br/c1-6(2)9-4-7-3-8(7)5-9;7-6-4-2-1-3-5-6/h6-8H,3-5H2,1-2H3;1-5H.
What are the key properties of bromobenzene;3-propan-2-yl-3-azabicyclo[3.1.0]hexane?
bromobenzene;3-propan-2-yl-3-azabicyclo[3.1.0]hexane has a molecular weight of 282.22 g/mol, XLogP of 3.80, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for bromobenzene;3-propan-2-yl-3-azabicyclo[3.1.0]hexane is sourced from PubChem (CID 166093012), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).