C24H25FN4O2 — CID 166093569
6-[2-amino-5-[3-[1-(dimethylamino)ethyl]-4-hydroxyphenyl]-6-fluoro-3-pyridinyl]-3,4-dihydro-2H-isoquinolin-1-one (PubChem CID 166093569) has the molecular formula C24H25FN4O2 and a molecular weight of 420.49 g/mol. Its IUPAC name is 6-[2-amino-5-[3-[1-(dimethylamino)ethyl]-4-hydroxyphenyl]-6-fluoro-3-pyridinyl]-3,4-dihydro-2H-isoquinolin-1-one.
| Compound Name | 6-[2-amino-5-[3-[1-(dimethylamino)ethyl]-4-hydroxyphenyl]-6-fluoro-3-pyridinyl]-3,4-dihydro-2H-isoquinolin-1-one |
|---|---|
| PubChem CID | 166093569 |
| Molecular Formula | C24H25FN4O2 |
| Molecular Weight | 420.49 g/mol |
| Exact Mass | 420.20 |
| IUPAC Name | 6-[2-amino-5-[3-[1-(dimethylamino)ethyl]-4-hydroxyphenyl]-6-fluoro-3-pyridinyl]-3,4-dihydro-2H-isoquinolin-1-one |
| SMILES | CC(c1cc(-c2cc(-c3ccc4c(c3)CCNC4=O)c(N)nc2F)ccc1O)N(C)C |
| InChI | InChI=1S/C24H25FN4O2/c1-13(29(2)3)18-11-15(5-7-21(18)30)19-12-20(23(26)28-22(19)25)14-4-6-17-16(10-14)8-9-27-24(17)31/h4-7,10-13,30H,8-9H2,1-3H3,(H2,26,28)(H,27,31) |
| InChIKey | OXIWOIPJUQMTIR-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 91.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.49 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|