C26H25F3N4O2 — CID 166093881
6-[2-amino-5-[4-[4-(2,2-difluoroethyl)morpholin-2-yl]phenyl]-6-fluoro-3-pyridinyl]-3,4-dihydro-2H-isoquinolin-1-one (PubChem CID 166093881) has the molecular formula C26H25F3N4O2 and a molecular weight of 482.51 g/mol. Its IUPAC name is 6-[2-amino-5-[4-[4-(2,2-difluoroethyl)morpholin-2-yl]phenyl]-6-fluoro-3-pyridinyl]-3,4-dihydro-2H-isoquinolin-1-one.
| Compound Name | 6-[2-amino-5-[4-[4-(2,2-difluoroethyl)morpholin-2-yl]phenyl]-6-fluoro-3-pyridinyl]-3,4-dihydro-2H-isoquinolin-1-one |
|---|---|
| PubChem CID | 166093881 |
| Molecular Formula | C26H25F3N4O2 |
| Molecular Weight | 482.51 g/mol |
| Exact Mass | 482.19 |
| IUPAC Name | 6-[2-amino-5-[4-[4-(2,2-difluoroethyl)morpholin-2-yl]phenyl]-6-fluoro-3-pyridinyl]-3,4-dihydro-2H-isoquinolin-1-one |
| SMILES | Nc1nc(F)c(-c2ccc(C3CN(CC(F)F)CCO3)cc2)cc1-c1ccc2c(c1)CCNC2=O |
| InChI | InChI=1S/C26H25F3N4O2/c27-23(28)14-33-9-10-35-22(13-33)16-3-1-15(2-4-16)20-12-21(25(30)32-24(20)29)17-5-6-19-18(11-17)7-8-31-26(19)34/h1-6,11-12,22-23H,7-10,13-14H2,(H2,30,32)(H,31,34) |
| InChIKey | YAQOTUBKVNTEHV-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 80.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.51 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|