C21H20FN3O — CID 166093949
N-[2-[5-(2-amino-6-fluoro-5-phenyl-3-pyridinyl)-2-methylphenyl]ethyl]formamide (PubChem CID 166093949) has the molecular formula C21H20FN3O and a molecular weight of 349.41 g/mol. Its IUPAC name is N-[2-[5-(2-amino-6-fluoro-5-phenyl-3-pyridinyl)-2-methylphenyl]ethyl]formamide.
| Compound Name | N-[2-[5-(2-amino-6-fluoro-5-phenyl-3-pyridinyl)-2-methylphenyl]ethyl]formamide |
|---|---|
| PubChem CID | 166093949 |
| Molecular Formula | C21H20FN3O |
| Molecular Weight | 349.41 g/mol |
| Exact Mass | 349.16 |
| IUPAC Name | N-[2-[5-(2-amino-6-fluoro-5-phenyl-3-pyridinyl)-2-methylphenyl]ethyl]formamide |
| SMILES | Cc1ccc(-c2cc(-c3ccccc3)c(F)nc2N)cc1CCNC=O |
| InChI | InChI=1S/C21H20FN3O/c1-14-7-8-17(11-16(14)9-10-24-13-26)19-12-18(20(22)25-21(19)23)15-5-3-2-4-6-15/h2-8,11-13H,9-10H2,1H3,(H2,23,25)(H,24,26) |
| InChIKey | QHRWHLMZWBWCAF-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.41 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|