C28H25F4N5O — CID 166094203
3-fluoro-6-methylidene-2-[4-(4-methylpiperazin-1-yl)-3-(trifluoromethyl)phenyl]-5,9,10,11-tetrahydroisoquinolino[7,6-c][1,8]naphthyridin-8-one (PubChem CID 166094203) has the molecular formula C28H25F4N5O and a molecular weight of 523.53 g/mol. Its IUPAC name is 3-fluoro-6-methylidene-2-[4-(4-methylpiperazin-1-yl)-3-(trifluoromethyl)phenyl]-5,9,10,11-tetrahydroisoquinolino[7,6-c][1,8]naphthyridin-8-one.
| Compound Name | 3-fluoro-6-methylidene-2-[4-(4-methylpiperazin-1-yl)-3-(trifluoromethyl)phenyl]-5,9,10,11-tetrahydroisoquinolino[7,6-c][1,8]naphthyridin-8-one |
|---|---|
| PubChem CID | 166094203 |
| Molecular Formula | C28H25F4N5O |
| Molecular Weight | 523.53 g/mol |
| Exact Mass | 523.20 |
| IUPAC Name | 3-fluoro-6-methylidene-2-[4-(4-methylpiperazin-1-yl)-3-(trifluoromethyl)phenyl]-5,9,10,11-tetrahydroisoquinolino[7,6-c][1,8]naphthyridin-8-one |
| SMILES | C=C1Nc2nc(F)c(-c3ccc(N4CCN(C)CC4)c(C(F)(F)F)c3)cc2-c2cc3c(cc21)C(=O)NCC3 |
| InChI | InChI=1S/C28H25F4N5O/c1-15-18-13-20-17(5-6-33-27(20)38)11-21(18)22-14-19(25(29)35-26(22)34-15)16-3-4-24(23(12-16)28(30,31)32)37-9-7-36(2)8-10-37/h3-4,11-14H,1,5-10H2,2H3,(H,33,38)(H,34,35) |
| InChIKey | HOIOONTXQJEMFO-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 60.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.53 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|