C24H25FN4O3S — CID 166094206
4-[6-amino-2-fluoro-5-(1-oxo-3,4-dihydro-2H-isoquinolin-6-yl)-3-pyridinyl]-N,N-diethylbenzenesulfonamide (PubChem CID 166094206) has the molecular formula C24H25FN4O3S and a molecular weight of 468.55 g/mol. Its IUPAC name is 4-[6-amino-2-fluoro-5-(1-oxo-3,4-dihydro-2H-isoquinolin-6-yl)-3-pyridinyl]-N,N-diethylbenzenesulfonamide.
| Compound Name | 4-[6-amino-2-fluoro-5-(1-oxo-3,4-dihydro-2H-isoquinolin-6-yl)-3-pyridinyl]-N,N-diethylbenzenesulfonamide |
|---|---|
| PubChem CID | 166094206 |
| Molecular Formula | C24H25FN4O3S |
| Molecular Weight | 468.55 g/mol |
| Exact Mass | 468.16 |
| IUPAC Name | 4-[6-amino-2-fluoro-5-(1-oxo-3,4-dihydro-2H-isoquinolin-6-yl)-3-pyridinyl]-N,N-diethylbenzenesulfonamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(-c2cc(-c3ccc4c(c3)CCNC4=O)c(N)nc2F)cc1 |
| InChI | InChI=1S/C24H25FN4O3S/c1-3-29(4-2)33(31,32)18-8-5-15(6-9-18)20-14-21(23(26)28-22(20)25)16-7-10-19-17(13-16)11-12-27-24(19)30/h5-10,13-14H,3-4,11-12H2,1-2H3,(H2,26,28)(H,27,30) |
| InChIKey | RCJQIHPBUWSYMW-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 105.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.55 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|