C26H25FN4O2 — CID 166094318
6-[5-[4-[(3aS,6aS)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-5-yl]phenyl]-2-amino-6-fluoro-3-pyridinyl]-3,4-dihydro-2H-isoquinolin-1-one (PubChem CID 166094318) has the molecular formula C26H25FN4O2 and a molecular weight of 444.51 g/mol. Its IUPAC name is 6-[5-[4-[(3aS,6aS)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-5-yl]phenyl]-2-amino-6-fluoro-3-pyridinyl]-3,4-dihydro-2H-isoquinolin-1-one.
| Compound Name | 6-[5-[4-[(3aS,6aS)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-5-yl]phenyl]-2-amino-6-fluoro-3-pyridinyl]-3,4-dihydro-2H-isoquinolin-1-one |
|---|---|
| PubChem CID | 166094318 |
| Molecular Formula | C26H25FN4O2 |
| Molecular Weight | 444.51 g/mol |
| Exact Mass | 444.20 |
| IUPAC Name | 6-[5-[4-[(3aS,6aS)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-5-yl]phenyl]-2-amino-6-fluoro-3-pyridinyl]-3,4-dihydro-2H-isoquinolin-1-one |
| SMILES | Nc1nc(F)c(-c2ccc(N3C[C@@H]4CCO[C@@H]4C3)cc2)cc1-c1ccc2c(c1)CCNC2=O |
| InChI | InChI=1S/C26H25FN4O2/c27-24-21(15-1-4-19(5-2-15)31-13-18-8-10-33-23(18)14-31)12-22(25(28)30-24)16-3-6-20-17(11-16)7-9-29-26(20)32/h1-6,11-12,18,23H,7-10,13-14H2,(H2,28,30)(H,29,32)/t18-,23+/m0/s1 |
| InChIKey | ARDDMLNRYBFVKF-FDDCHVKYSA-N |
| XLogP | 3.65 |
| TPSA | 80.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.51 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|