About 6-(2-amino-5-bromo-6-fluoro-3-pyridinyl)-3,4-dihydro-2H-2,7-naphthyridin-1-one
6-(2-amino-5-bromo-6-fluoro-3-pyridinyl)-3,4-dihydro-2H-2,7-naphthyridin-1-one (PubChem CID 166094466) has the molecular formula C13H10BrFN4O
and a molecular weight of 337.15 g/mol. Its IUPAC name is 6-(2-amino-5-bromo-6-fluoro-3-pyridinyl)-3,4-dihydro-2H-2,7-naphthyridin-1-one.
Molecular Properties
| Compound Name | 6-(2-amino-5-bromo-6-fluoro-3-pyridinyl)-3,4-dihydro-2H-2,7-naphthyridin-1-one |
| PubChem CID | 166094466 |
| Molecular Formula | C13H10BrFN4O |
| Molecular Weight | 337.15 g/mol |
| Exact Mass | 336.00 |
| IUPAC Name | 6-(2-amino-5-bromo-6-fluoro-3-pyridinyl)-3,4-dihydro-2H-2,7-naphthyridin-1-one |
| SMILES | Nc1nc(F)c(Br)cc1-c1cc2c(cn1)C(=O)NCC2 |
| InChI | InChI=1S/C13H10BrFN4O/c14-9-4-7(12(16)19-11(9)15)10-3-6-1-2-17-13(20)8(6)5-18-10/h3-5H,1-2H2,(H2,16,19)(H,17,20) |
| InChIKey | ZMELFXBHSYCAOX-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 337.15 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 6-(2-amino-5-bromo-6-fluoro-3-pyridinyl)-3,4-dihydro-2H-2,7-naphthyridin-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(2-amino-5-bromo-6-fluoro-3-pyridinyl)-3,4-dihydro-2H-2,7-naphthyridin-1-one?
The IUPAC name of 6-(2-amino-5-bromo-6-fluoro-3-pyridinyl)-3,4-dihydro-2H-2,7-naphthyridin-1-one (CID 166094466) is 6-(2-amino-5-bromo-6-fluoro-3-pyridinyl)-3,4-dihydro-2H-2,7-naphthyridin-1-one.
What is the SMILES notation for 6-(2-amino-5-bromo-6-fluoro-3-pyridinyl)-3,4-dihydro-2H-2,7-naphthyridin-1-one?
The canonical SMILES for 6-(2-amino-5-bromo-6-fluoro-3-pyridinyl)-3,4-dihydro-2H-2,7-naphthyridin-1-one is Nc1nc(F)c(Br)cc1-c1cc2c(cn1)C(=O)NCC2.
What is the InChIKey of 6-(2-amino-5-bromo-6-fluoro-3-pyridinyl)-3,4-dihydro-2H-2,7-naphthyridin-1-one?
The InChIKey is ZMELFXBHSYCAOX-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10BrFN4O/c14-9-4-7(12(16)19-11(9)15)10-3-6-1-2-17-13(20)8(6)5-18-10/h3-5H,1-2H2,(H2,16,19)(H,17,20).
What are the key properties of 6-(2-amino-5-bromo-6-fluoro-3-pyridinyl)-3,4-dihydro-2H-2,7-naphthyridin-1-one?
6-(2-amino-5-bromo-6-fluoro-3-pyridinyl)-3,4-dihydro-2H-2,7-naphthyridin-1-one has a molecular weight of 337.15 g/mol, XLogP of 1.91, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(2-amino-5-bromo-6-fluoro-3-pyridinyl)-3,4-dihydro-2H-2,7-naphthyridin-1-one is sourced from PubChem (CID 166094466), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).