C25H25FN4O — CID 166094576
6-[2-amino-6-fluoro-5-[3-(1-methylpyrrolidin-2-yl)phenyl]-3-pyridinyl]-3,4-dihydro-2H-isoquinolin-1-one (PubChem CID 166094576) has the molecular formula C25H25FN4O and a molecular weight of 416.50 g/mol. Its IUPAC name is 6-[2-amino-6-fluoro-5-[3-(1-methylpyrrolidin-2-yl)phenyl]-3-pyridinyl]-3,4-dihydro-2H-isoquinolin-1-one.
| Compound Name | 6-[2-amino-6-fluoro-5-[3-(1-methylpyrrolidin-2-yl)phenyl]-3-pyridinyl]-3,4-dihydro-2H-isoquinolin-1-one |
|---|---|
| PubChem CID | 166094576 |
| Molecular Formula | C25H25FN4O |
| Molecular Weight | 416.50 g/mol |
| Exact Mass | 416.20 |
| IUPAC Name | 6-[2-amino-6-fluoro-5-[3-(1-methylpyrrolidin-2-yl)phenyl]-3-pyridinyl]-3,4-dihydro-2H-isoquinolin-1-one |
| SMILES | CN1CCCC1c1cccc(-c2cc(-c3ccc4c(c3)CCNC4=O)c(N)nc2F)c1 |
| InChI | InChI=1S/C25H25FN4O/c1-30-11-3-6-22(30)18-5-2-4-15(13-18)20-14-21(24(27)29-23(20)26)16-7-8-19-17(12-16)9-10-28-25(19)31/h2,4-5,7-8,12-14,22H,3,6,9-11H2,1H3,(H2,27,29)(H,28,31) |
| InChIKey | RIQKTGHQMUZIIX-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 71.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.50 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|