C22H26Cl2N4O4 — CID 166094854
1,3-oxazol-2-yl 3-[[3-[2-[4-(2,3-dichlorophenyl)piperazin-1-yl]ethyl]cyclobutyl]amino]-3-oxopropanoate (PubChem CID 166094854) has the molecular formula C22H26Cl2N4O4 and a molecular weight of 481.38 g/mol. Its IUPAC name is 1,3-oxazol-2-yl 3-[[3-[2-[4-(2,3-dichlorophenyl)piperazin-1-yl]ethyl]cyclobutyl]amino]-3-oxopropanoate.
| Compound Name | 1,3-oxazol-2-yl 3-[[3-[2-[4-(2,3-dichlorophenyl)piperazin-1-yl]ethyl]cyclobutyl]amino]-3-oxopropanoate |
|---|---|
| PubChem CID | 166094854 |
| Molecular Formula | C22H26Cl2N4O4 |
| Molecular Weight | 481.38 g/mol |
| Exact Mass | 480.13 |
| IUPAC Name | 1,3-oxazol-2-yl 3-[[3-[2-[4-(2,3-dichlorophenyl)piperazin-1-yl]ethyl]cyclobutyl]amino]-3-oxopropanoate |
| SMILES | O=C(CC(=O)Oc1ncco1)NC1CC(CCN2CCN(c3cccc(Cl)c3Cl)CC2)C1 |
| InChI | InChI=1S/C22H26Cl2N4O4/c23-17-2-1-3-18(21(17)24)28-9-7-27(8-10-28)6-4-15-12-16(13-15)26-19(29)14-20(30)32-22-25-5-11-31-22/h1-3,5,11,15-16H,4,6-10,12-14H2,(H,26,29) |
| InChIKey | YTMLDJXGRKOJDG-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 87.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.38 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|