About 5-bromo-3-(4-chloro-2-fluorophenyl)-3-(fluoromethyl)-2H-1,4-benzodioxine
5-bromo-3-(4-chloro-2-fluorophenyl)-3-(fluoromethyl)-2H-1,4-benzodioxine (PubChem CID 166094969) has the molecular formula C15H10BrClF2O2
and a molecular weight of 375.60 g/mol. Its IUPAC name is 5-bromo-3-(4-chloro-2-fluorophenyl)-3-(fluoromethyl)-2H-1,4-benzodioxine.
Molecular Properties
| Compound Name | 5-bromo-3-(4-chloro-2-fluorophenyl)-3-(fluoromethyl)-2H-1,4-benzodioxine |
| PubChem CID | 166094969 |
| Molecular Formula | C15H10BrClF2O2 |
| Molecular Weight | 375.60 g/mol |
| Exact Mass | 373.95 |
| IUPAC Name | 5-bromo-3-(4-chloro-2-fluorophenyl)-3-(fluoromethyl)-2H-1,4-benzodioxine |
| SMILES | FCC1(c2ccc(Cl)cc2F)COc2cccc(Br)c2O1 |
| InChI | InChI=1S/C15H10BrClF2O2/c16-11-2-1-3-13-14(11)21-15(7-18,8-20-13)10-5-4-9(17)6-12(10)19/h1-6H,7-8H2 |
| InChIKey | UZOOZVCDMWCPEZ-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 375.60 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-bromo-3-(4-chloro-2-fluorophenyl)-3-(fluoromethyl)-2H-1,4-benzodioxine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-3-(4-chloro-2-fluorophenyl)-3-(fluoromethyl)-2H-1,4-benzodioxine?
The IUPAC name of 5-bromo-3-(4-chloro-2-fluorophenyl)-3-(fluoromethyl)-2H-1,4-benzodioxine (CID 166094969) is 5-bromo-3-(4-chloro-2-fluorophenyl)-3-(fluoromethyl)-2H-1,4-benzodioxine.
What is the SMILES notation for 5-bromo-3-(4-chloro-2-fluorophenyl)-3-(fluoromethyl)-2H-1,4-benzodioxine?
The canonical SMILES for 5-bromo-3-(4-chloro-2-fluorophenyl)-3-(fluoromethyl)-2H-1,4-benzodioxine is FCC1(c2ccc(Cl)cc2F)COc2cccc(Br)c2O1.
What is the InChIKey of 5-bromo-3-(4-chloro-2-fluorophenyl)-3-(fluoromethyl)-2H-1,4-benzodioxine?
The InChIKey is UZOOZVCDMWCPEZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H10BrClF2O2/c16-11-2-1-3-13-14(11)21-15(7-18,8-20-13)10-5-4-9(17)6-12(10)19/h1-6H,7-8H2.
What are the key properties of 5-bromo-3-(4-chloro-2-fluorophenyl)-3-(fluoromethyl)-2H-1,4-benzodioxine?
5-bromo-3-(4-chloro-2-fluorophenyl)-3-(fluoromethyl)-2H-1,4-benzodioxine has a molecular weight of 375.60 g/mol, XLogP of 4.88, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-3-(4-chloro-2-fluorophenyl)-3-(fluoromethyl)-2H-1,4-benzodioxine is sourced from PubChem (CID 166094969), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).