About 3-azabicyclo[3.1.0]hexane;2,3-dihydro-1,4-benzoxathiine
3-azabicyclo[3.1.0]hexane;2,3-dihydro-1,4-benzoxathiine (PubChem CID 166097158) has the molecular formula C13H17NOS
and a molecular weight of 235.35 g/mol. Its IUPAC name is 3-azabicyclo[3.1.0]hexane;2,3-dihydro-1,4-benzoxathiine.
Molecular Properties
| Compound Name | 3-azabicyclo[3.1.0]hexane;2,3-dihydro-1,4-benzoxathiine |
| PubChem CID | 166097158 |
| Molecular Formula | C13H17NOS |
| Molecular Weight | 235.35 g/mol |
| Exact Mass | 235.10 |
| IUPAC Name | 3-azabicyclo[3.1.0]hexane;2,3-dihydro-1,4-benzoxathiine |
| SMILES | C1NCC2CC12.c1ccc2c(c1)OCCS2 |
| InChI | InChI=1S/C8H8OS.C5H9N/c1-2-4-8-7(3-1)9-5-6-10-8;1-4-2-6-3-5(1)4/h1-4H,5-6H2;4-6H,1-3H2 |
| InChIKey | WEQHMCZIHLISHU-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.35 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-azabicyclo[3.1.0]hexane;2,3-dihydro-1,4-benzoxathiine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-azabicyclo[3.1.0]hexane;2,3-dihydro-1,4-benzoxathiine?
The IUPAC name of 3-azabicyclo[3.1.0]hexane;2,3-dihydro-1,4-benzoxathiine (CID 166097158) is 3-azabicyclo[3.1.0]hexane;2,3-dihydro-1,4-benzoxathiine.
What is the SMILES notation for 3-azabicyclo[3.1.0]hexane;2,3-dihydro-1,4-benzoxathiine?
The canonical SMILES for 3-azabicyclo[3.1.0]hexane;2,3-dihydro-1,4-benzoxathiine is C1NCC2CC12.c1ccc2c(c1)OCCS2.
What is the InChIKey of 3-azabicyclo[3.1.0]hexane;2,3-dihydro-1,4-benzoxathiine?
The InChIKey is WEQHMCZIHLISHU-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8OS.C5H9N/c1-2-4-8-7(3-1)9-5-6-10-8;1-4-2-6-3-5(1)4/h1-4H,5-6H2;4-6H,1-3H2.
What are the key properties of 3-azabicyclo[3.1.0]hexane;2,3-dihydro-1,4-benzoxathiine?
3-azabicyclo[3.1.0]hexane;2,3-dihydro-1,4-benzoxathiine has a molecular weight of 235.35 g/mol, XLogP of 2.40, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-azabicyclo[3.1.0]hexane;2,3-dihydro-1,4-benzoxathiine is sourced from PubChem (CID 166097158), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).