C17H17ClN6O2 — CID 16609772
1-[(2-chlorophenyl)methyl]-3,7,9-trimethyl-4H-purino[8,7-c][1,2,4]triazine-6,8-dione (PubChem CID 16609772) has the molecular formula C17H17ClN6O2 and a molecular weight of 372.82 g/mol. Its IUPAC name is 1-[(2-chlorophenyl)methyl]-3,7,9-trimethyl-4H-purino[8,7-c][1,2,4]triazine-6,8-dione.
| Compound Name | 1-[(2-chlorophenyl)methyl]-3,7,9-trimethyl-4H-purino[8,7-c][1,2,4]triazine-6,8-dione |
|---|---|
| PubChem CID | 16609772 |
| Molecular Formula | C17H17ClN6O2 |
| Molecular Weight | 372.82 g/mol |
| Exact Mass | 372.11 |
| IUPAC Name | 1-[(2-chlorophenyl)methyl]-3,7,9-trimethyl-4H-purino[8,7-c][1,2,4]triazine-6,8-dione |
| SMILES | CC1=NN(Cc2ccccc2Cl)c2nc3c(c(=O)n(C)c(=O)n3C)n2C1 |
| InChI | InChI=1S/C17H17ClN6O2/c1-10-8-23-13-14(21(2)17(26)22(3)15(13)25)19-16(23)24(20-10)9-11-6-4-5-7-12(11)18/h4-7H,8-9H2,1-3H3 |
| InChIKey | MONNKZOEGNPXET-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 77.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.82 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |